Introduction：Basic information about 4-[(4-Morpholinylthio)thioxomethyl]-morpholine CAS 13752-51-7, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
4-[(4-Morpholinylthio)thioxomethyl]-morpholine Basic information
| Product Name: | 4-[(4-Morpholinylthio)thioxomethyl]-morpholine |
| Synonyms: | 4-[(4-Morpholinylthio)thioxomethyl]-morpholine;ACCELERATOR OTOS;CURE-RITE 18;N-OXYDIETHYLENE THIOCARBAMYL-N-OXYDIETHYLENE SULFENAMIDE;morpholin-4-yl morpholine-4-carbodithioate;4-((4-morpholinylthio)thioxomethyl)-morpholin;4-((morpholinothiocarbonyl)thio)-morpholin;4-((morpholinothiocarbonyl)thio)morpholine |
| CAS: | 13752-51-7 |
| MF: | C9H16N2O2S2 |
| MW: | 248.37 |
| EINECS: | 237-335-9 |
| Product Categories: | |
| Mol File: | 13752-51-7.mol |
|
4-[(4-Morpholinylthio)thioxomethyl]-morpholine Chemical Properties
| Melting point | 139 °C |
| Boiling point | 378.1±52.0 °C(Predicted) |
| density | 1.2971 (rough estimate) |
| vapor pressure | 0.001Pa at 25℃ |
| refractive index | 1.6800 (estimate) |
| pka | 1.08±0.20(Predicted) |
| Water Solubility | 127mg/L at 20℃ |
| InChI | InChI=1S/C9H16N2O2S2/c14-9(10-1-5-12-6-2-10)15-11-3-7-13-8-4-11/h1-8H2 |
| InChIKey | HOEFWOBLOGZQIQ-UHFFFAOYSA-N |
| SMILES | N1(C(=S)SN2CCOCC2)CCOCC1 |
| LogP | 1.65 |
| EPA Substance Registry System | N-Oxydiethylenethiocarbamyl-N'-oxydiethylenesulfenamide (13752-51-7) |
Safety Information
| TSCA | TSCA listed |
| Toxicity | dnr-esc 100 mg/plate ENMUDM 5,193,83 |
4-[(4-Morpholinylthio)thioxomethyl]-morpholine Usage And Synthesis
| Uses | Acceleratorotos is an accelerator; used in preparation of a Rubber anti-fatigue agent. |
| Safety Profile | Experimental reproductive effects. Mutation data reported. When heated to decomposition it emits toxic vapors of NOx and SOx. |
4-[(4-Morpholinylthio)thioxomethyl]-morpholine Preparation Products And Raw materials
