Introduction：Basic information about 4-Amino-2,6-dichlorophenol CAS 5930-28-9, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
4-Amino-2,6-dichlorophenol Basic information
| Product Name: | 4-Amino-2,6-dichlorophenol |
| Synonyms: | 3,5-Dichloro-4-hydroxyaniline;4-amino-2,6-dichloro-pheno;4-Amino-2,6-Dichlorophenol 2,6-Dichloro-4-Aminophenol;2,6-dichloro-4-chloro phenol;2,6-dichloro-4-amine phenol;4-Amino-2,6-dichlorophenol, 97+%;4-AMINO-2,6-DICHLOROPHENOL / 3,5-DICHLORO-4-HYDROXYANILINE;4-amino-2,6-dichlorophen-3,5-D2-ol |
| CAS: | 5930-28-9 |
| MF: | C6H5Cl2NO |
| MW: | 178.02 |
| EINECS: | 227-671-4 |
| Product Categories: | Organic Building Blocks;Oxygen Compounds;Phenols;Dyestuff Intermediates;Aromatic Phenols;Phenoles and thiophenoles |
| Mol File: | 5930-28-9.mol |
|
4-Amino-2,6-dichlorophenol Chemical Properties
| Melting point | 167-170 °C (lit.) |
| Boiling point | 303.6±42.0 °C(Predicted) |
| density | 1.2549 (rough estimate) |
| refractive index | 1.5680 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | soluble in Methanol |
| pka | 7.29±0.23(Predicted) |
| form | Powder |
| color | Beige or slightly brown to pale reddish |
| BRN | 2361665 |
| Stability: | Stable. Incompatible with acids, acid chlorides, acid anhydrides, chloroformates, strong oxidizing agents. |
| InChI | InChI=1S/C6H5Cl2NO/c7-4-1-3(9)2-5(8)6(4)10/h1-2,10H,9H2 |
| InChIKey | KGEXISHTCZHGFT-UHFFFAOYSA-N |
| SMILES | C1(O)=C(Cl)C=C(N)C=C1Cl |
| CAS DataBase Reference | 5930-28-9(CAS DataBase Reference) |
| NIST Chemistry Reference | Phenol, 4-amino-2,6-dichloro-(5930-28-9) |
| EPA Substance Registry System | Phenol, 4-amino-2,6-dichloro- (5930-28-9) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| RTECS | SJ5774500 |
| TSCA | TSCA listed |
| HS Code | 29222990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2 |
4-Amino-2,6-dichlorophenol Usage And Synthesis
4-Amino-2,6-dichlorophenol Preparation Products And Raw materials
| Raw materials | Diethylene glycol-->2,6-Dichloro-4-nitrophenol |
| Preparation Products | 1-(4-AMINO-2,6-DICHLOROPHENOXY)-3-(PYRROLIDIN-1-YL)PROPAN-2-OL-->4-(1-METHYLPIPERIDIN-4-YLOXY)-3,5-DICHLOROBENZENAMINE-->4-(2-(DIMETHYLAMINO)ETHOXY)-3,5-DICHLOROBENZENAMINE-->2,6-DICHLOROPHENOLINDOPHENOL-->4-(3-(DIMETHYLAMINO)PROPOXY)-3,5-DICHLOROBENZENAMINE-->1-(2-(4-AMINO-2,6-DICHLOROPHENOXY)ETHYL)PYRROLIDIN-2-ONE-->3,5-Dichloro-4-(1,1,2,2-tetrafluoroethoxy)aniline |
