Introduction：Basic information about 4-Bromo-3-fluoroanisole CAS 408-50-4, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
4-Bromo-3-fluoroanisole Basic information
| Product Name: | 4-Bromo-3-fluoroanisole |
| Synonyms: | 3-fluoro-4-bromophenyl methyl ether |
| CAS: | 408-50-4 |
| MF: | C7H6BrFO |
| MW: | 205.02 |
| EINECS: | |
| Product Categories: | |
| Mol File: | 408-50-4.mol |
|
4-Bromo-3-fluoroanisole Chemical Properties
| InChI | InChI=1S/C7H6BrFO/c1-10-5-2-3-6(8)7(9)4-5/h2-4H,1H3 |
| InChIKey | XANVIFOBBVAKCY-UHFFFAOYSA-N |
| SMILES | C1(OC)C=CC(Br)=C(F)C=1 |
| CAS DataBase Reference | 408-50-4(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 22-52 |
4-Bromo-3-fluoroanisole Usage And Synthesis
| Uses | A halo-aryl compound used in the preparation of orally available mGlu1 receptor enhancers. |
4-Bromo-3-fluoroanisole Preparation Products And Raw materials
