Introduction：Basic information about 4-Bromo-3-fluorobenzotrifluoride CAS 40161-54-4, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
4-Bromo-3-fluorobenzotrifluoride Basic information
| Product Name: | 4-Bromo-3-fluorobenzotrifluoride |
| Synonyms: | 2-FLUORO-4-(TRIFLUOROMETHYL)BROMOBENZENE;1-Bromo-2-fluoro-4-(trifluoromethyl)benzene~2-Fluoro-4-(trifluoromethyl)bromobenzene;3-fluoro-4-bromobenzotrifluoride;1-BROMO-2-FLUORO-4-(TRIFLUOROMETHYL)BENZENE;4-Bromo-3-fluorobenzotrifluoride 97%;4-Bromo-3-fluorobenzotrifluoride97%;4-BROMO-3-FLUOROBENZOTRIFLUORIDE;4-BROMO-3-FLUOROBENZOTRIFLUORIDE, 98.5% |
| CAS: | 40161-54-4 |
| MF: | C7H3BrF4 |
| MW: | 243 |
| EINECS: | |
| Product Categories: | Fluorine series;Trifluoromethylbenzene serise |
| Mol File: | 40161-54-4.mol |
|
4-Bromo-3-fluorobenzotrifluoride Chemical Properties
| Boiling point | 154-155°C |
| density | 1.72 |
| refractive index | 1.46 |
| Fp | 154-155°C |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Colorless to Almost colorless |
| BRN | 2641902 |
| InChI | InChI=1S/C7H3BrF4/c8-5-2-1-4(3-6(5)9)7(10,11)12/h1-3H |
| InChIKey | XCTQZIUCYJVRLJ-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC=C(C(F)(F)F)C=C1F |
| CAS DataBase Reference | 40161-54-4(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22-51-36-38-37 |
| Safety Statements | 26-36/37/39-36-37 |
| HazardClass | IRRITANT |
| HS Code | 29039990 |
4-Bromo-3-fluorobenzotrifluoride Usage And Synthesis
| Chemical Properties | liquid |
| Uses | 4-BroMo-3-fluorobenzotrifluoride is a useful Laboratory chemical，and it can auses skin irritation and eye irritation. |
4-Bromo-3-fluorobenzotrifluoride Preparation Products And Raw materials
| Preparation Products | 3-Fluorobenzotrifluoride |
