Introduction：Basic information about 4-Bromophenylhydrazine hydrochloride CAS 622-88-8, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
4-Bromophenylhydrazine hydrochloride Basic information
| Product Name: | 4-Bromophenylhydrazine hydrochloride |
| Synonyms: | BUTTPARK 96\57-56;LABOTEST-BB LT01143342;[(4-bromophenyl)amino]azanium chloride;Hydrazine, (p-bromophenyl)-, monohydrochloride;Hydrazine, (p-bromophenyl)-, monohydrochloride (8CI);HYDRAZINE, 1-(p-BROMOPHENYL)-, HYDROCHLORIDE;p-Bromophenylhydrazine monohydrochloride;WLN: ZMR DE &GH |
| CAS: | 622-88-8 |
| MF: | C6H8BrClN2 |
| MW: | 223.5 |
| EINECS: | 628-672-6 |
| Product Categories: | Fine chemical;Hydrazines;Phenylhydrazine;Nitrogen Compounds;Organic Building Blocks |
| Mol File: | 622-88-8.mol |
|
4-Bromophenylhydrazine hydrochloride Chemical Properties
| Melting point | 220-230 °C (dec.)(lit.) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Crystalline Powder |
| color | Light gray to light brown-beige |
| Water Solubility | Soluble in water. |
| Sensitive | Hygroscopic |
| BRN | 3565838 |
| InChI | InChI=1S/C6H7BrN2.ClH/c7-5-1-3-6(9-8)4-2-5;/h1-4,9H,8H2;1H |
| InChIKey | RGGOWBBBHWTTRE-UHFFFAOYSA-N |
| SMILES | N(C1=CC=C(Br)C=C1)N.[H]Cl |
| CAS DataBase Reference | 622-88-8(CAS DataBase Reference) |
| EPA Substance Registry System | Hydrazine, (4-bromophenyl)-, monohydrochloride (622-88-8) |
Safety Information
| Hazard Codes | C,Xi,T |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45-28A |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| RTECS | MV0800000 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT, TOXIC |
| PackingGroup | Ⅱ |
| HS Code | 29280090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |
4-Bromophenylhydrazine hydrochloride Usage And Synthesis
| Chemical Properties | white to light yellow crystal powde |
| Uses | 4-Bromophenylhydrazine hydrochloride is used as a reagent in the preparation of acylsulfonamides, acylsulfamides and 9-bromo-2-ethenyl-7,12-dihydroindolo[3,2-d][1]benzazepin-6(5H)-one. |
| Uses | 4-Bromophenylhydrazine hydrochloride was used as reagent in the synthesis of:
- acylsulfonamides and acylsulfamides
- 9-bromo-2-ethenyl-7,12-dihydroindolo[3,2-d][1]benzazepin-6(5H)-one
|
4-Bromophenylhydrazine hydrochloride Preparation Products And Raw materials
| Preparation Products | 7-BROMO-1,2,3,4-TETRAHYDROCYCLOPENTA[B]INDOLE-->5-BROMO-3-METHYLINDOLE-->2-bromo-5,6,7,8,9,10-hexahydrocyclohepta[b]indole-->6-BROMO-2,3,4,9-TETRAHYDRO-1H-CARBAZOL-1-ONE-->5-Bromoindole-2-carboxylic acid methyl ester-->Ethyl 5-Bromoindole-2-carboxylate-->5-BroMo-3-Methyl-2-phenyl-1H-indole-->5-AMINO-1-(4-BROMO-PHENYL)-1H-PYRAZOLE-4-CARBOXYLIC ACID-->2-(4-Bromo-phenyl)-2H-phthalazin-1-one |
