Introduction:Basic information about 4-Bromotetraphenylsilane CAS 18737-40-1, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
4-Bromotetraphenylsilane Basic information
| Product Name: | 4-Bromotetraphenylsilane |
| Synonyms: | 4-Bromotetraphenylsilane;Benzene, 1-broMo-4-(triphenylsilyl)-Silane, (4-broMophenyl)triphenyl- (9CI);(4-Bromophenyl)triphenylsilane;Benzene, 1-bromo-4-(triphenylsilyl)-;Benzene, 1-bromo-4-(triphenylsilyl)-4-Bromotetraphenylsilane;(4-Bromophenyl)triphenylsilan;4-Bromotetraphenylsilane >4-Bromo-tretraphenylsilane |
| CAS: | 18737-40-1 |
| MF: | C24H19BrSi |
| MW: | 415.4 |
| EINECS: | |
| Product Categories: | Silanes;Si (Classes of Silicon Compounds);Si-(C)4 Compounds |
| Mol File: | 18737-40-1.mol |
|
4-Bromotetraphenylsilane Chemical Properties
| Melting point | 175 °C |
| Boiling point | 462.9±37.0 °C(Predicted) |
| density | 1.30±0.1 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystal |
| color | White to Almost white |
| InChI | InChI=1S/C24H19BrSi/c25-20-16-18-24(19-17-20)26(21-10-4-1-5-11-21,22-12-6-2-7-13-22)23-14-8-3-9-15-23/h1-19H |
| InChIKey | UDZSLJULKCKKPX-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC=C([Si](C2=CC=CC=C2)(C2=CC=CC=C2)C2=CC=CC=C2)C=C1 |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 22 |
| WGK Germany | 3 |
| HS Code | 2931.90.9010 |
4-Bromotetraphenylsilane Usage And Synthesis
| Uses | 4-Bromotetraphenylsilane is mainly used in analytical fields and organic synthesis. |
4-Bromotetraphenylsilane Preparation Products And Raw materials