Introduction：Basic information about 4-Epoxypropanoxycarbazole CAS 51997-51-4, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
4-Epoxypropanoxycarbazole Basic information
| Product Name: | 4-Epoxypropanoxycarbazole |
| Synonyms: | Carvedilol Related Compound D (USP);4-EPOXYPROPANOXYCARBAZOLE;Carvedilol Epoxide Impurity;4-(2-Oxiranylmethyoxy)-9H-carbazole;4-OXIRANYLMETHOXY-9H-CARBAZOLE;4-GLYCIDYLOXYCARBAZOLE;4-(2-OXIRANYLMETHOXY)-9H-CARBAZOLE;Epoxide of Carvedilol |
| CAS: | 51997-51-4 |
| MF: | C15H13NO2 |
| MW: | 239.27 |
| EINECS: | 610-764-2 |
| Product Categories: | Impurities;pharma material;Aromatics;Aromatics Compounds;Carbazoles;Oxiranes;Simple 3-Membered Ring Compounds;Carvedilol Intermediate;(intermediate of carvedilol);Chemical intermediate for Benidipin;PHARMACEUTICAL INTERMEDIATES |
| Mol File: | 51997-51-4.mol |
|
4-Epoxypropanoxycarbazole Chemical Properties
| Melting point | 130-132°C |
| Boiling point | 464.9±15.0 °C(Predicted) |
| density | 1.327±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 16.59±0.30(Predicted) |
| color | Off-White to Light Brown |
| BRN | 918742 |
| Major Application | pharmaceutical (small molecule) |
| InChI | InChI=1S/C15H13NO2/c1-2-5-12-11(4-1)15-13(16-12)6-3-7-14(15)18-9-10-8-17-10/h1-7,10,16H,8-9H2 |
| InChIKey | SVWKIGRDISDRLO-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=CC=C2)C2=C1C=CC=C2OCC1CO1 |
| CAS DataBase Reference | 51997-51-4(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,Xn |
| Risk Statements | 43-68 |
| Safety Statements | 36/37 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2
Muta. 2
Skin Sens. 1B |
4-Epoxypropanoxycarbazole Usage And Synthesis
| Chemical Properties | Pale Yellow to Almost White Powder |
| Uses | 4-(2,3-Epoxypropoxy)carbazole (Carvedilol EP Impurity D; Carvedilol USP-D) is an intermediate in the synthesis of Carvedilol (C184625). |
4-Epoxypropanoxycarbazole Preparation Products And Raw materials
| Raw materials | Benzenesulfonic acid, 3-nitro-, 2-oxiranylmethyl ester-->(S)-Oxiran-2-ylMethyl Methanesulfonate-->Cephaloridine-->1-Bromo-2,3-epoxypropane-->Epichlorohydrin-->Dimethyl sulfoxide-->4-Hydroxy carbazole |
| Preparation Products | Carvedilol Impurity 3-->N-2-Hydroxy-3-[[2-(Methoxyphenoxy)ethyl]aMine Carvedilol |
