Introduction：Basic information about 4E10Z-14Ac CAS 105700-87-6, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
4E10Z-14Ac Basic information
| Product Name: | 4E10Z-14Ac |
| Synonyms: | 4E10Z-14Ac;4,10-Tetradecadien-1-ol, 1-acetate, (4E,10Z)-;4,10-tetradecadien-1-ol, acetate, (E,Z)- |
| CAS: | 105700-87-6 |
| MF: | C16H28O2 |
| MW: | 252.39 |
| EINECS: | |
| Product Categories: | |
| Mol File: | 105700-87-6.mol |
|
4E10Z-14Ac Chemical Properties
| Boiling point | 297.8±9.0 °C(Predicted) |
| density | 0.890±0.06 g/cm3(Predicted) |
| InChI | InChI=1S/C16H28O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-18-16(2)17/h5-6,11-12H,3-4,7-10,13-15H2,1-2H3/b6-5-,12-11+ |
| InChIKey | YZOOWCSDLNGLOI-OXHHXQHLSA-N |
| SMILES | C(OC(=O)C)CC/C=C/CCCC/C=C\CCC |
Safety Information
4E10Z-14Ac Usage And Synthesis
| Uses | (4E,10Z)-Tetradecadienyl Acetate is the major sex pheromone of the apple leafminer moth, Phyllonorycter ringoniella. |
4E10Z-14Ac Preparation Products And Raw materials
