Introduction：Basic information about 4-Hydrazinylbenzoic acid CAS 619-67-0, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
4-Hydrazinylbenzoic acid Basic information
| Product Name: | 4-Hydrazinylbenzoic acid |
| Synonyms: | 4-Hydrazinobenzoic acid,98%;4-Hydrazinobenzoic acid pure;Phenylhydrazine-p-carbo-xylic acid;Deferasirox Hydrazino IMpurity;Deferasirox Impurity 11;4-hydrazino-benzoicaci;p-hydrazino-benzoicaci;P-HYDRAZINOBENZOIC ACID |
| CAS: | 619-67-0 |
| MF: | C7H8N2O2 |
| MW: | 152.15 |
| EINECS: | 210-609-5 |
| Product Categories: | Nitrogen Compounds;Organic Building Blocks;Aromatic Hydrazides, Hydrazines, Hydrazones and Oximes;Aromatic Carboxylic Acids, Amides, Anilides, Anhydrides & Salts;Benzene series;Hydrazines;Organic acids;john's |
| Mol File: | 619-67-0.mol |
|
4-Hydrazinylbenzoic acid Chemical Properties
| Melting point | 218 °C (dec.) (lit.) |
| Boiling point | 274.61°C (rough estimate) |
| density | 1.2804 (rough estimate) |
| refractive index | 1.5200 (estimate) |
| Fp | >110° |
| storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C |
| solubility | DMSO (Slightly), Methanol (Slightly, Heated) |
| pka | 4.14±0.10(Predicted) |
| form | Crystalline Powder |
| color | Light yellow to light brown |
| BRN | 387378 |
| Stability: | Stable. Combustible. Incompatible with strong acids, strong oxidizing agents. |
| InChI | InChI=1S/C7H8N2O2/c8-9-6-3-1-5(2-4-6)7(10)11/h1-4,9H,8H2,(H,10,11) |
| InChIKey | PCNFLKVWBDNNOW-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(NN)C=C1 |
| CAS DataBase Reference | 619-67-0(CAS DataBase Reference) |
| EPA Substance Registry System | Benzoic acid, 4-hydrazino- (619-67-0) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 1 |
| RTECS | DH1700000 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HS Code | 29280000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
4-Hydrazinylbenzoic acid Usage And Synthesis
| Chemical Properties | solid |
| Uses | 4-Hydrazinobenzoic acid was used in the synthesis of multi-substituted dihydropyrano[2,3-c]pyrazole derivatives. |
| Purification Methods | The hydrochloride [24589-37-3] M 188.6, has m 253o(dec) [Beilstein 15 III 837]. |
4-Hydrazinylbenzoic acid Preparation Products And Raw materials
| Preparation Products | Deferasirox-->4-(5-AMINO-3-TERT-BUTYL-PYRAZOL-1-YL)-BENZOIC ACID-->tert-butyl 8-[(4-Methylpiperidin-1-yl)carbonyl]-1,3,4,5-tetrahydro-2H-pyrido[4,3-b]indole-2-carboxylate |
