4-Iodophenylhydrazine CAS 13116-27-3
Introduction：Basic information about 4-Iodophenylhydrazine CAS 13116-27-3, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
4-Iodophenylhydrazine Basic information
| Product Name: | 4-Iodophenylhydrazine |
| Synonyms: | JR-8449, 4-Iodophenylhydrazine, 97%;4-IODOPHENYLHYDRAZINE;BUTTPARK 43\57-23;1-(4-IODOPHENYL)HYDRAZINE;4-IODOPHENYLHYDRAZINE, 95+%;1-(4-Iodophenyl)hydrazine, 95+%;1-Hydrazino-4-iodobenzene;4-Iodophenylhydrazine 95% |
| CAS: | 13116-27-3 |
| MF: | C6H7IN2 |
| MW: | 234.04 |
| EINECS: | |
| Product Categories: | Building Blocks;Chemical Synthesis;Aromatic Hydrazides, Hydrazines, Hydrazones and Oximes;Phenyls & Phenyl-Het;Nitrogen Compounds;Organic Building Blocks;Phenyls & Phenyl-Het;Hydrazines;Nitrogen Compounds;Organic Building Blocks |
| Mol File: | 13116-27-3.mol |
4-Iodophenylhydrazine Chemical Properties
| Melting point | 102-106 °C (lit.) |
| Boiling point | 304.8±25.0 °C(Predicted) |
| density | 1.981±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C |
| form | solid |
| pka | 4.91±0.20(Predicted) |
| color | Tan |
| Water Solubility | Insoluble in water. |
| Sensitive | Light Sensitive |
| BRN | 742475 |
| InChI | InChI=1S/C6H7IN2/c7-5-1-3-6(9-8)4-2-5/h1-4,9H,8H2 |
| InChIKey | IQMLCMKMSBMMGR-UHFFFAOYSA-N |
| SMILES | N(C1=CC=C(I)C=C1)N |
| CAS DataBase Reference | 13116-27-3(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/37/38-43-40-20/21/22 |
| Safety Statements | 26-45-36/37/39-24-36/37 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| Hazard Note | Harmful/Light Sensitive |
| HazardClass | IRRITANT-HARMFUL, LIGHT SENSITIVE |
| PackingGroup | III |
| HS Code | 29280000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |
| Chemical Properties | White to orange-brown crystalline powder |
| Uses | It can be used in agrochemical, pharmaceutical and dyestuff field. |
4-Iodophenylhydrazine Preparation Products And Raw materials
| Preparation Products | 4-Iodobiphenyl-->4,4'-Diiodobiphenyl-->5-iodo-2,3,3-trimethyl-3H-indole |
