Introduction：Basic information about 4-Methoxy-N,6-dimethyl-1,3,5-triazin-2-amine CAS 5248-39-5, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Table of Contents
- 1. 4-Methoxy-N,6-dimethyl-1,3,5-triazin-2-amine Basic information
- 2. 4-Methoxy-N,6-dimethyl-1,3,5-triazin-2-amine Chemical Properties
- 3. Safety Information
- 4. 4-Methoxy-N,6-dimethyl-1,3,5-triazin-2-amine Usage And Synthesis
- 5. 4-Methoxy-N,6-dimethyl-1,3,5-triazin-2-amine Preparation Products And Raw materials
4-Methoxy-N,6-dimethyl-1,3,5-triazin-2-amine Basic information
| Product Name: | 4-Methoxy-N,6-dimethyl-1,3,5-triazin-2-amine |
| Synonyms: | 2-METHYLAMINO-4-METHYL-6-METHOXY-1,3,5-TRIAZINE;2-METHOXY-4-METHYL-6-(METHYLAMINO)-1,3,5-TRIAZINE;2-methoxy-4-methyl-6-methylamino-s-triazine;2-AMINO-4-METHYL-6-METHOXY(N-METHYL)-1,3,5-TRIAZINE;4-methoxy-n,6-dimethyl-1,3,5-triazin-2-amine;4-METHOXY-N,6-DIMETHYL-1,3,5-TRIAZIN-2-YLAMINE;N,6-DIMETHYL-4-METHOXY-1,3,5-TRIAZIN-2-YLAMINE;5-triazin-2-amine,4-methoxy-n,6-dimethyl-3 |
| CAS: | 5248-39-5 |
| MF: | C6H10N4O |
| MW: | 154.17 |
| EINECS: | 401-360-5 |
| Product Categories: | Building Blocks;Heterocyclic Building Blocks;Triazines |
| Mol File: | 5248-39-5.mol |
|
4-Methoxy-N,6-dimethyl-1,3,5-triazin-2-amine Chemical Properties
| Melting point | 162-166 °C(lit.) |
| Boiling point | 304.9±25.0 °C(Predicted) |
| density | 1.196±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | DMSO (Slightly, Heated), Methanol (Slightly, Heated) |
| pka | 3.80±0.10(Predicted) |
| form | Solid |
| color | Pale Beige |
| InChI | InChI=1S/C6H10N4O/c1-4-8-5(7-2)10-6(9-4)11-3/h1-3H3,(H,7,8,9,10) |
| InChIKey | MNDSUSQBIDHEJU-UHFFFAOYSA-N |
| SMILES | N1=C(C)N=C(OC)N=C1NC |
| CAS DataBase Reference | 5248-39-5(CAS DataBase Reference) |
| EPA Substance Registry System | 1,3,5-Triazin-2-amine, 4-methoxy-N,6-dimethyl- (5248-39-5) |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38-48-48/22-37-21/22 |
| Safety Statements | 26-36-22-2-36/37 |
| WGK Germany | 3 |
| RTECS | XY2905180 |
| TSCA | TSCA listed |
| HS Code | 2933698090 |
4-Methoxy-N,6-dimethyl-1,3,5-triazin-2-amine Usage And Synthesis
| Uses | 4-Methoxy-n,6-dimethyl-1,3,5-triazin-2-amine is a metabolite of tribenuron-methyl used in herbicidal formulations or used as herbicides. |
4-Methoxy-N,6-dimethyl-1,3,5-triazin-2-amine Preparation Products And Raw materials
| Raw materials | Hydrochloric acid-->Methanol-->Sodium carbonate-->Acetic anhydride-->Sodium Methoxide-->Formic acid-->Methylamine-->N,N-Dimethylacetamide-->Methyl bromide-->METSULFURON METHYL-->Dicyandiamide-->Metaclazepam-->DimethylCarbonate-->2-Chloro-4-methyl-6-methoxy-1,3,5-triazine-->2,4-DIMETHOXY-6-METHYL-1,3,5-TRIAZINE-->Tribenuron methyl |
