4-Methyl-2-nitroaniline CAS 89-62-3
Introduction：Basic information about 4-Methyl-2-nitroaniline CAS 89-62-3, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
4-Methyl-2-nitroaniline Basic information
| Product Name: | 4-Methyl-2-nitroaniline |
| Synonyms: | Meta Nitro Para Toluidine(MNPT)- 3 Nitro 4 Toluidine;4-methyl-2-nitro-Benzenamine;4-Methyl-6-nitroaniline;2-NITRO-PARA-TOLUIDINE;ORTHO-NITRO-PARA-TOLUIDINE;5-Nitro-4-amino-1-methylbenzol;4-METHYL-2-NITROANILINE / 2-NITRO-P-TOLUIDINE;2-Nitro-p-toluidine (NH2=1) (C.I. 37110) |
| CAS: | 89-62-3 |
| MF: | C7H8N2O2 |
| MW: | 152.15 |
| EINECS: | 201-924-9 |
| Product Categories: | Aromatics;Intermediates;Intermediates of Dyes and Pigments;Amines;blocks;NitroCompounds;bc0001;K00001 |
| Mol File: | 89-62-3.mol |
4-Methyl-2-nitroaniline Chemical Properties
| Melting point | 115-116 °C (lit.) |
| Boiling point | 169°C (21 mmHg) |
| density | 1,164 g/cm3 |
| vapor pressure | 0.06Pa at 25℃ |
| refractive index | 1.6276 (estimate) |
| Fp | 157°C |
| storage temp. | −20°C |
| solubility | 0.2g/l |
| Colour Index | 37110 |
| form | Fine Crystalline Powder |
| pka | 0.46±0.10(Predicted) |
| color | Orange to orange-brown |
| Water Solubility | Soluble in water (0.2 g/L at 20°C). |
| BRN | 879506 |
| InChI | 1S/C7H8N2O2/c1-5-2-3-6(8)7(4-5)9(10)11/h2-4H,8H2,1H3 |
| InChIKey | DLURHXYXQYMPLT-UHFFFAOYSA-N |
| SMILES | Cc1ccc(N)c(c1)[N+]([O-])=O |
| LogP | 0.568 at 23℃ |
| CAS DataBase Reference | 89-62-3(CAS DataBase Reference) |
| NIST Chemistry Reference | 3-Nitro-4-aminotoluene(89-62-3) |
| EPA Substance Registry System | 4-Methyl-2-nitroaniline (89-62-3) |
Safety Information
| Hazard Codes | T,N,Xi |
| Risk Statements | 23/24/25-33-51/53 |
| Safety Statements | 28-36/37-45-61 |
| RIDADR | UN 2660 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | XU8227250 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29214300 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Aquatic Chronic 2 STOT RE 2 |
| Toxicity | LD50 intraperitoneal in mouse: > 500mg/kg |
| Chemical Properties | orange to orange-brown fine crystalline powder |
| Uses | 4-Methyl-2-nitroaniline is used as a red azo dye. |
| Definition | ChEBI: A C-nitro compound in which the nitro compound is ortho to the amino group and meta to the methyl group of p-toluidine. |
| Preparation | 4-Methyl-2-nitrobenzenamine in oblate sulfuric acid and saponification. |
| Production Methods | N-Acetyl-p-toluidine is nitrated with mixed acid, and the quenched reaction mixture is heated and hydrolyzed to 3-nitro-p-toluidine. |
| General Description | Red crystals or bright orange powder. |
| Air & Water Reactions | Insoluble in water. |
| Reactivity Profile | 4-Methyl-2-nitroaniline is incompatible with acids, acid chlorides, acid anhydrides, chloroformates, and strong oxidizers . |
| Fire Hazard | 4-Methyl-2-nitroaniline is combustible. |
| Flammability and Explosibility | Non flammable |
4-Methyl-2-nitroaniline Preparation Products And Raw materials
| Raw materials | Sodium hydroxide-->Sulfuric acid-->Nitric acid-->Sodium nitrite-->Sodium bisulfite-->Tosyl chloride-->Benzenesulfonyl chloride-->p-Toluidine-->p-Acetotoluidide-->Benzamide, N-(4-methyl-2-nitrophenyl)--->ethyl p-tolylcarbamate-->4-Methyl-2-nitroaniline |
| Preparation Products | 5-(BROMOMETHYL)-2,1,3-BENZOXADIAZOLE-->HANSA YELLOW 10G-->Pigment Red 13-->3,4-Dinitrobenzoic acid-->Pigment Red 3-->Fast Yellow G-->3,4-Diaminotoluene-->2-Bromo-5-methylbenzenamine-->3,4-Dichlorotoluene-->4-Bromo-3-nitrotoluene-->CC-90003-->AZOIC DIAZO COMPONENT 39-->Fast Yellow G |
