Introduction：Basic information about 4-Methyl-2-nitrobenzonitrile CAS 26830-95-5, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
4-Methyl-2-nitrobenzonitrile Basic information
| Product Name: | 4-Methyl-2-nitrobenzonitrile |
| Synonyms: | 2-NITRO-P-TOLUNITRILE;2-NITRO-P-TOLUONITRILE;4-METHYL-2-NITROBENZONITRILE;2-nitro-4-toluonitrile;4-Methyl-2-nitrobenzonitrile,99%;3-(4-chlorophenyl)-5-cyclohexyl-1,3,5-thiadiazinane-2-thione;2-Nitro-p-tolunitrile>Benzonitrile, 4-methyl-2-nitro- |
| CAS: | 26830-95-5 |
| MF: | C8H6N2O2 |
| MW: | 162.15 |
| EINECS: | 248-019-5 |
| Product Categories: | Aromatics Compounds;Aromatics |
| Mol File: | 26830-95-5.mol |
|
4-Methyl-2-nitrobenzonitrile Chemical Properties
| Melting point | 97-99 °C(lit.) |
| Boiling point | 288.82°C (rough estimate) |
| density | 1.3264 (rough estimate) |
| refractive index | 1.5770 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Soluble in methanol. |
| form | Solid |
| color | White Crystalline |
| InChI | 1S/C8H6N2O2/c1-6-2-3-7(5-9)8(4-6)10(11)12/h2-4H,1H3 |
| InChIKey | QGBSLPHQCUIZKK-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C#N)c(c1)[N+]([O-])=O |
| CAS DataBase Reference | 26830-95-5(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 36-26 |
| RIDADR | 3439 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral |
4-Methyl-2-nitrobenzonitrile Usage And Synthesis
| Chemical Properties | White Crystalline Solid |
| Uses | 4-Methyl-2-nitrobenzonitrile is used in the preparation of 4-cyano-3-nitrobenzyl bromide. |
| Uses | 4-Methyl-2-nitrobenzonitrile was used in the preparation of 4-cyano-3-nitrobenzyl bromide. |
4-Methyl-2-nitrobenzonitrile Preparation Products And Raw materials
| Preparation Products | 2-CYANO-5-METHYLBENZENESULFONYL CHLORIDE-->2-Amino-4-methylbenzoic acid-->4-METHYL-2-NITROBENZOIC ACID-->2-Amino-4-methylbenzamide |
