Introduction：Basic information about 5-BroMo-5′-hexyl-2,2′-bithiophene CAS 655249-04-0, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
5-BroMo-5′-hexyl-2,2′-bithiophene Basic information
| Product Name: | 5-BroMo-5′-hexyl-2,2′-bithiophene |
| Synonyms: | 2-(5-Bromothiophen-2-yl)-5-hexylthiophene;5-Bromo-5'-hexyl-2,2'-bithiophene 98%;2-bromo-5-(5-hexylthiophene-2-yl)thiophene;2-bromo-5-(5-hexylthiophen-2-yl)thiophene;5-BroMo-5′-hexyl-2,2′-bithiophene;2,2'-Bithiophene, 5-bromo-5'-hexyl-;S1173;5-Bromo-5'-hexyl-2,2'-bithiophene |
| CAS: | 655249-04-0 |
| MF: | C14H17BrS2 |
| MW: | 329.32 |
| EINECS: | |
| Product Categories: | |
| Mol File: | 655249-04-0.mol |
|
5-BroMo-5′-hexyl-2,2′-bithiophene Chemical Properties
| Melting point | 35-40°C |
| Boiling point | 364.6±37.0 °C(Predicted) |
| density | 1.324±0.06 g/cm3(Predicted) |
| Fp | >110℃ |
| form | solid |
| InChI | InChI=1S/C14H17BrS2/c1-2-3-4-5-6-11-7-8-12(16-11)13-9-10-14(15)17-13/h7-10H,2-6H2,1H3 |
| InChIKey | QNMUCNVCVAUOQU-UHFFFAOYSA-N |
| SMILES | C1(C2SC(CCCCCC)=CC=2)SC(Br)=CC=1 |
Safety Information
| Hazard Codes | T |
| Risk Statements | 25 |
| Safety Statements | 45 |
| RIDADR | UN 2811 6.1 / PGIII |
| WGK Germany | 3 |
| Storage Class | 6.1D - Non-combustible acute toxic Cat.3
toxic hazardous materials or hazardous materials causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |
5-BroMo-5′-hexyl-2,2′-bithiophene Usage And Synthesis
5-BroMo-5′-hexyl-2,2′-bithiophene Preparation Products And Raw materials
