Introduction:Basic information about 5-Hydroxy-1,7-diphenyl-6-hepten-3-one CAS 87095-74-7, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
5-Hydroxy-1,7-diphenyl-6-hepten-3-one Basic information
| Product Name: | 5-Hydroxy-1,7-diphenyl-6-hepten-3-one |
| Synonyms: | 5-Hydroxy-1,7-diphenyl-6-hepten-3-one;[R-(E)]-5-Hydroxy-1,7-diphenyl-6-hepten-3-one;E]-5-Hydroxy-1,7-diphenyl-6-hepten-3-one;5-Hydroxy-1,7-diphenylhept-6-en-3-one;5-HYDROXY-1,7-DIPHENYL-6-HEPTEN-;(5R)-trans-1,7-diphenyl-5-hydroxy-6-hepten-3-one;(5R,6E)-5-Hydroxy-1,7-diphenyl-6-hepten-3-one;(5R)-trans-1,7-diphenyl-5-hydroxy-6-hept |
| CAS: | 87095-74-7 |
| MF: | C19H20O2 |
| MW: | 280.36 |
| EINECS: | 2017-001-1 |
| Product Categories: | |
| Mol File: | 87095-74-7.mol |
|
5-Hydroxy-1,7-diphenyl-6-hepten-3-one Chemical Properties
| storage temp. | 2-8°C |
| solubility | Soluble in DMSO and methanol; |
| form | Powder |
| color | White to off-white |
| Water Solubility | insoluble in water |
| InChI | 1S/C19H20O2/c20-18(13-11-16-7-3-1-4-8-16)15-19(21)14-12-17-9-5-2-6-10-17/h1-11,13,18,20H,12,14-15H2/b13-11+ |
| InChIKey | NEQGOKAKPXXESR-ACCUITESSA-N |
| SMILES | O[C@@H](/C=C/C1=CC=CC=C1)CC(CCC2=CC=CC=C2)=O |
Safety Information
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
5-Hydroxy-1,7-diphenyl-6-hepten-3-one Usage And Synthesis
| Uses | (5R,6E)-5-Hydroxy-1,7-diphenyl-6-hepten-3-one is the methylene chloride extract of Alpinia nutans, has antioxidant activity[1]. |
| References | [1] M. Habsah, et al. The Antioxidative Components from Alpinia nutans. 《Pharmaceutical Biology》 |
5-Hydroxy-1,7-diphenyl-6-hepten-3-one Preparation Products And Raw materials