Introduction:Basic information about 6”-O-xylosyl-glycitin CAS 231288-18-9, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
6”-O-xylosyl-glycitin Basic information
| Product Name: | 6”-O-xylosyl-glycitin |
| Synonyms: | 6”-O-xylosyl-glycitin;-O-xylosyl-glycitin;4H-1-Benzopyran-4-one, 3-(4-hydroxyphenyl)-6-methoxy-7-[(6-O-β-D-xylopyranosyl-β-D-glucopyranosyl)oxy]-;6''Oxylosylglycitin,6'' O xylosyl glycitin;6''-O-xylosyl-glycitin;6''''-O-xylosyl-glycitin, 10 mM in DMSO;6''''-O-xylosyl-glycitin |
| CAS: | 231288-18-9 |
| MF: | C27H30O14 |
| MW: | 578.52 |
| EINECS: | |
| Product Categories: | |
| Mol File: | 231288-18-9.mol |
|
6”-O-xylosyl-glycitin Chemical Properties
| Boiling point | 888.3±65.0 °C(Predicted) |
| density | 1.66±0.1 g/cm3(Predicted) |
| pka | 9.62±0.30(Predicted) |
| InChIKey | MYJXWCIZOOKQLK-ZZKQEZQGNA-N |
| SMILES | O=C1C(C2C=CC(O)=CC=2)=COC2=CC(O[C@H]3[C@@H]([C@@H](O)[C@H](O)[C@@H](CO[C@@H]4OC[C@@H](O)[C@H](O)[C@H]4O)O3)O)=C(OC)C=C12 |&1:16,17,18,20,22,25,28,30,32,r| |
Safety Information
6”-O-xylosyl-glycitin Usage And Synthesis
| Uses | 6''-O-Xylosylglycitin is a natural isoflavonoid compound found in the flower of Pueraria thunbergiana Benth[1]. |
| References | [1] K T Lee, et al. Tectorigenin, an isoflavone of Pueraria thunbergiana Benth., induces differentiation and apoptosis in human promyelocytic leukemia HL-60 cells. Biol Pharm Bull. 2001 Oct;24(10):1117-21. DOI:10.1248/bpb.24.1117 |
6”-O-xylosyl-glycitin Preparation Products And Raw materials