Introduction：Basic information about 6-Amino-3,4-dihydro-1(2H)-naphthalenone CAS 3470-53-9, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
6-Amino-3,4-dihydro-1(2H)-naphthalenone Basic informationApplication
| Product Name: | 6-Amino-3,4-dihydro-1(2H)-naphthalenone |
| Synonyms: | 6-AMINO-1,2,3,4-TETRAHYDRONAPHTHALEN-1-ONE;6-AMINO-1,2,3,4-TETRAHYDRO NAPTHALENE-1-ONE;6-AMINO-3,4-DIHYDRO-2H-NAPHTHALEN-1-ONE;6-AMINO-3,4-DIHYDRONAPHTHALEN-1(2H)-ONE;6-Amino-3,4-dihydro-1(2H)-naphthalenone;6-AMINO-1,2,3,4-TETRAHYDRONAPHTHALENE-1-ONE;6-Amino-3,4-dihydronaphthalene-1(2H)-one;6-Aminotetralin-1-one |
| CAS: | 3470-53-9 |
| MF: | C10H11NO |
| MW: | 161.2 |
| EINECS: | |
| Product Categories: | Fused Ring Systems;Amines |
| Mol File: | 3470-53-9.mol |
|
6-Amino-3,4-dihydro-1(2H)-naphthalenone Chemical Properties
| Melting point | 130 °C |
| Boiling point | 359.4±31.0 °C(Predicted) |
| density | 1.193±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 2.20±0.20(Predicted) |
| color | Light yellow to Brown |
| Sensitive | Moisture Sensitive |
| InChI | InChI=1S/C10H11NO/c11-8-4-5-9-7(6-8)2-1-3-10(9)12/h4-6H,1-3,11H2 |
| InChIKey | BEVVUJBVEXJGKM-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C(C=C(N)C=C2)CCC1 |
| CAS DataBase Reference | 3470-53-9(CAS DataBase Reference) |
Safety Information
| Hazard Codes | T;Xn,Xi,Xn,T |
| Risk Statements | 20/21/22-25 |
| Safety Statements | 22-26-36/37/39-45 |
| RIDADR | UN 2811 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| HS Code | 2921450090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |
6-Amino-3,4-dihydro-1(2H)-naphthalenone Usage And Synthesis
| Application | 6-Amino-1,2,3,4-Tetrahydro-1-naphthone is mainly used as a pharmaceutical and chemical intermediate in the synthesis of other substances. |
| Chemical Properties | Beige to yellow powder |
| Definition | ChEBI: 6-Amino-1,2,3,4-tetrahydronaphthalen-1-one is a member of tetralins. |
6-Amino-3,4-dihydro-1(2H)-naphthalenone Preparation Products And Raw materials
| Preparation Products | 2-NAPHTHALENAMINE, 5,6,7,8-TETRAHYDRO--->6-CYANO-1-TETRALONE-->benzyl 5-oxo-5,6,7,8-tetrahydronaphthalen-2-ylcarbaMate-->6-(piperidin-1-yl)-3,4-dihydronaphthalen-1(2H)-one-->6-Morpholino-3,4-dihydronaphthalen-1(2H)-one-->ethyl 5-oxo-5,6,7,8-tetrahydronaphthalene-2-carboxylate-->6-BROMO-TETRAL-1-ON-->6-Chloro-1-tetralone |
