Introduction：Basic information about 6-benzylaminopurine hydrochloride CAS 162714-86-5, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
6-benzylaminopurine hydrochloride Basic information
| Product Name: | 6-benzylaminopurine hydrochloride |
| Synonyms: | BENZYLAMINOPURINE, 6-;BENZYL-(7H-PURIN-6-YL)-AMINE;BA;BAP;6BAP;6-BA;6-BENZYLADENINE 6-BENZYLAMINOPURINE;6-BENZYLADENINE |
| CAS: | 162714-86-5 |
| MF: | C12H11N5.ClH |
| MW: | 261.71 |
| EINECS: | 627-481-5 |
| Product Categories: | |
| Mol File: | 162714-86-5.mol |
|
6-benzylaminopurine hydrochloride Chemical Properties
| Melting point | 230-233 °C |
| storage temp. | 2-8°C |
| solubility | H2O: soluble |
| form | powder |
| Water Solubility | H2O: soluble |
| Major Application | agriculture |
| InChI | InChI=1S/C12H11N5.ClH/c1-2-4-9(5-3-1)6-13-11-10-12(15-7-14-10)17-8-16-11;/h1-5,7-8H,6H2,(H2,13,14,15,16,17);1H |
| InChIKey | VQVCNMLGIVVDOS-UHFFFAOYSA-N |
| SMILES | C12NC=NC=1N=CN=C2NCC1=CC=CC=C1.Cl |
| CAS DataBase Reference | 162714-86-5(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | AU6252200 |
| Hazard Note | Harmful |
| Storage Class | 11 - Combustible Solids |
6-benzylaminopurine hydrochloride Usage And Synthesis
| Uses | N-Benzyl-9H-purin-6-amine Hydrochloride can be used as reagent/reactant of N6-substituted adenines and as protonated benzylaminopurine and creatinine salts for synthetic preparation of ruthenium DMSO chloro zwitterionic inner-sphere complexes. |
| General Description | 6-benzylaminopurine (6-BAP), a synthetic phytohormone, is a first-generation pesticide. |
| Biochem/physiol Actions | 6-Benzylaminopurine (6-BAP), a cytokinin, can promote the growth and development of plants. It helps to set blossoms, initiate fruit maturity and blocks respiratory kinase in plants. 6-BAP is capable of enhancing post harvest life of green vegetables. |
6-benzylaminopurine hydrochloride Preparation Products And Raw materials
| Raw materials | Benzyl chloride-->Benzylamine-->6-Benzylaminopurine-->6-Hydroxypurine-->Ribavirin |
