Introduction：Basic information about 7-Amino-3-chloro cephalosporanic acid CAS 53994-69-7, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
7-Amino-3-chloro cephalosporanic acid Basic information
| Product Name: | 7-Amino-3-chloro cephalosporanic acid |
| Synonyms: | (6R,7R)-7-Amino-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic;Cefaclor Impurity 2(Cefaclor EP Impurity B);7-amino-3-chloro-8-oxo-,(6R,7R)-5-Thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylicacid;7-AMINO-3-CHLORO-3-CEPHEM-4-CARBOXYLIC ACID;7-AMINO-3-CHLORO-8-OXO-5-THIA-1-AZA-BICYCLO-[4.2.0]OCT-2-ENE-2-CARBOXYLIC ACID;7-AMINO-3-CHLORO CEPHALOSPORANIC ACID;(6R-trans)-7-amino-3-chloro-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;7-amino-3-coloro-3-cephem-4-carboxylic acid |
| CAS: | 53994-69-7 |
| MF: | C7H7ClN2O3S |
| MW: | 234.66 |
| EINECS: | 258-907-4 |
| Product Categories: | Amines;Chiral Reagents;Heterocycles;Intermediates & Fine Chemicals;Pharmaceuticals;Sulfur & Selenium Compounds;Organic acids |
| Mol File: | 53994-69-7.mol |
|
7-Amino-3-chloro cephalosporanic acid Chemical Properties
| Melting point | >180°C (dec.) |
| Boiling point | 498.9±45.0 °C(Predicted) |
| density | 1.81±0.1 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| solubility | Aqueous Acid (Slightly, Heated), DMSO (Slightly, Heated, Sonicated) |
| form | Solid |
| pka | 1.87±0.50(Predicted) |
| color | Pale Yellow |
| InChI | InChI=1S/C7H7ClN2O3S/c8-2-1-14-6-3(9)5(11)10(6)4(2)7(12)13/h3,6H,1,9H2,(H,12,13)/t3-,6-/m1/s1 |
| InChIKey | OQSAFIZCBAZPMY-AWFVSMACSA-N |
| SMILES | N12[C@@]([H])([C@H](N)C1=O)SCC(Cl)=C2C(O)=O |
| CAS DataBase Reference | 53994-69-7(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| HazardClass | IRRITANT |
7-Amino-3-chloro cephalosporanic acid Usage And Synthesis
| Chemical Properties | Pale Yellow Solid |
| Uses | 7-Amino-3-chloro cephalosporanic acid is used as an intermediate in the preparation of semi-synthetic cephalosprin antibiotics. |
7-Amino-3-chloro cephalosporanic acid Preparation Products And Raw materials
| Preparation Products | 7-Amino-3-cephem-4-carboxylic acid |
