Introduction：Basic information about 7-Ethyl tryptophol CAS 41340-36-7, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
7-Ethyl tryptophol Basic information
| Product Name: | 7-Ethyl tryptophol |
| Synonyms: | 3-(7-ETHYLINDOLE)ETHANOL;7-Ethyl-3-indoleethanol;7-ETHYLTRYPTOPHOL;7-ETHYL-1H-INDOLE-3-ETHANOL;7-ETHYL-3-(2-HYDROXYETHYL)INDOLE;2-(7-Ethylindol-3-yl)ethanol;2-(3a-ethyl-3aH-indol-3-yl)ethanol;2-(7-ETHYL-1H-INDOL-3-YL)-ETHANOL |
| CAS: | 41340-36-7 |
| MF: | C12H15NO |
| MW: | 189.25 |
| EINECS: | 431-020-1 |
| Product Categories: | Indole derivatives;Intermediates & Fine Chemicals;Pharmaceuticals;INTERMEDIATESOFETODOLAC |
| Mol File: | 41340-36-7.mol |
|
7-Ethyl tryptophol Chemical Properties
| Melting point | 44-45°C |
| Boiling point | 377.8±27.0 °C(Predicted) |
| density | 1.146±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 14.98±0.10(Predicted) |
| color | White to Pale Beige |
| Major Application | pharmaceutical (small molecule) |
| InChI | InChI=1S/C12H15NO/c1-2-9-4-3-5-11-10(6-7-14)8-13-12(9)11/h3-5,8,13-14H,2,6-7H2,1H3 |
| InChIKey | UVSDNCAZVSQJQA-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=CC=C2CC)C(CCO)=C1 |
| CAS DataBase Reference | 41340-36-7(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn;N,N,Xn |
| Risk Statements | 22-48/22-51/53 |
| Safety Statements | 2-36/37/39-61 |
| RIDADR | 3077 |
| WGK Germany | WGK 2 |
| RTECS | NL8512200 |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 2933998090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral
Aquatic Chronic 2
STOT RE 2 |
7-Ethyl tryptophol Usage And Synthesis
| Chemical Properties | Pale Beige Solid |
| Uses | 7-Ethyltryptophol (Etodolac EP Impurity H) is a key intermediate in the preparation of the non-steroidal anti-inflammatory drug Etodolac. |
| Uses | Key intermediate in the preparation of the non-steroidal anti-inflammatory drug Etodolac. |
7-Ethyl tryptophol Preparation Products And Raw materials
| Raw materials | Tryptophol-->Etodolac-->7-ETHYLISATIN-->7-ETHYLTRYPTOPHOL-->2-ETHOXYTETRAHYDROFURAN-->4-hydroxybutanal-->2,3-Dihydrofuran-->Ethylene glycol |
