Introduction：Basic information about CAS 889877-77-4|(7R)-2-Chloro-7-ethyl-7,8-dihydro-8-(1-methylethyl)-6(5H)-pteridinone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (7R)-2-Chloro-7-ethyl-7,8-dihydro-8-(1-methylethyl)-6(5H)-pteridinone |
|---|
| CAS Number | 889877-77-4 | Molecular Weight | 254.716 |
|---|
| Density | 1.224 | Boiling Point | 465.7±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H15ClN4O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 235.4±27.3 °C |
|---|
Names
| Name | (7R)-2-Chloro-7-ethyl-8-isopropyl-7,8-dihydro-6(5H)-pteridinone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.224 |
|---|
| Boiling Point | 465.7±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H15ClN4O |
|---|
| Molecular Weight | 254.716 |
|---|
| Flash Point | 235.4±27.3 °C |
|---|
| Exact Mass | 254.093445 |
|---|
| PSA | 61.61000 |
|---|
| LogP | 1.43 |
|---|
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
|---|
| Index of Refraction | 1.539 |
|---|
| InChIKey | HZKCDOWKVNPXCW-MRVPVSSYSA-N |
|---|
| SMILES | CCC1C(=O)Nc2cnc(Cl)nc2N1C(C)C |
|---|
Synonyms
| (7R)-2-Chloro-7-ethyl-7,8-dihydro-8-(1-methylethyl)-6(5H)-pteridinone |
| (R)-2-chloro-6-(oxiran-2-ylmethoxy)benzonitrile |
| 2-chloro-1-phenyl ethanol |
| (R)-2-chloro-1-(m-chlorophenyl)ethanol |
| (7R)-2-Chloro-7-ethyl-8-isopropyl-7,8-dihydro-6(5H)-pteridinone |
| 6(5H)-Pteridinone, 2-chloro-7-ethyl-7,8-dihydro-8-(1-methylethyl)-, (7R)- |
| Benzenemethanol,3-chloro-a-(chloromethyl)-,(aR) |
| 2-chloro-1-(3'-chlorophenyl)ethanol |
| 2-chloro-6-([(2R)-2-oxiranylmethyl]oxy)benzonitrile |
| (R)-2-chloro-7-ethyl-8-isopropyl-7,8-dihydropteridin-6(5H)-one |
| (7R)-2-chloro-7-ethyl-8-isopropyl-7,8-dihydro-5H-pteridin-6-one |
| (R)-2-chloro-1-phenyl ethanol |
| (R)-1-(3-chlorophenyl)-2-chloro-1-hydroxyethane |
| (R)-2-chloro-1-(3-chlorophenyl)ethanol |
| (7R)-2-chloro-7-ethyl-8-isopropyl-5,7-dihydropteridin-6-one |
