Introduction：Basic information about 9-(BroMoMethyl)nonadecane CAS 69620-20-8, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
9-(BroMoMethyl)nonadecane Basic information
| Product Name: | 9-(BroMoMethyl)nonadecane |
| Synonyms: | 9-(BroMoMethyl)nonadecane;1-bromo-2-octyldodecane;C812Br;Nonadecane, 9-(bromomethyl)-;EA490 |
| CAS: | 69620-20-8 |
| MF: | C20H41Br |
| MW: | 361.44 |
| EINECS: | |
| Product Categories: | OPV,OLED;Aliphatics |
| Mol File: | 69620-20-8.mol |
|
9-(BroMoMethyl)nonadecane Chemical Properties
| Melting point | -5 °C |
| Boiling point | 195°C/0.4mmHg(lit.) |
| density | 0.971±0.06 g/cm3(Predicted) |
| refractive index | 1.4620 to 1.4660 |
| storage temp. | Refrigerator |
| solubility | Chloroform, Ethyl Acetate (Slightly) |
| form | Oil |
| color | Colourless to Pale Yellow |
| InChI | InChI=1S/C20H41Br/c1-3-5-7-9-11-12-14-16-18-20(19-21)17-15-13-10-8-6-4-2/h20H,3-19H2,1-2H3 |
| InChIKey | XSQSDBVMLJNZKU-UHFFFAOYSA-N |
| SMILES | CCCCCCCCC(CBr)CCCCCCCCCC |
Safety Information
9-(BroMoMethyl)nonadecane Usage And Synthesis
| Uses | 9-(Bromomethyl)-Nonadecane can be used in fused structures of the donor-acceptor-type conjugated polymer backbones. These polymers can be multifunctional materials and used in electrochromic and photovoltaic applications. |
9-(BroMoMethyl)nonadecane Preparation Products And Raw materials
| Preparation Products | 2-Octyldodecylamine-->2-(2-octyldodecyl) |
