Introduction:Basic information about 9,9-Bis[4-(2-acryloyloxyethyloxy)phenyl]fluorene CAS 161182-73-6, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
9,9-Bis[4-(2-acryloyloxyethyloxy)phenyl]fluorene Basic information
| Product Name: | 9,9-Bis[4-(2-acryloyloxyethyloxy)phenyl]fluorene |
| Synonyms: | 9,9-BIS[4-(2-ACRYLOYLOXYETHYLOXY)PHENYL]FLUORENE;2-Propenoic acid 9H-fluoren-9-ylidene-bis(4,1-phenyleneoxy-2,1-ethanediyl) ester;9,9-Bis[4-2-Acryloloxyethoxy)phenyl] fluorene;9,9-Bis(4-(2-acryloxyethoxy)phenyl)fluorene;(((9H-Fluorene-9,9-diyl)bis(4,1-phenylene))bis(oxy))bis(ethane-2,1-diyl) diacrylate;9,9-BIS[4-(2-ACRYLOYLOXYETHOXY)PHENYL]FLUORENE;(((9H-Fluorene-9,9-diyl);bis(4,1-phenylene) |
| CAS: | 161182-73-6 |
| MF: | C35H30O6 |
| MW: | 546.61 |
| EINECS: | |
| Product Categories: | |
| Mol File: | 161182-73-6.mol |
|
9,9-Bis[4-(2-acryloyloxyethyloxy)phenyl]fluorene Chemical Properties
| Boiling point | 671.3±55.0 °C(Predicted) |
| density | 1.208 |
| storage temp. | Amber Vial, Refrigerator, Under inert atmosphere |
| solubility | Chloroform (Sparingly), Methanol (Slightly, Heated, Sonicated) |
| form | Oil |
| color | Colourless |
| Stability: | Light Sensitive |
| InChIKey | YCPMSWJCWKUXRH-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=C(OCCOC(=O)C=C)C=C2)(C2=CC=C(OCCOC(=O)C=C)C=C2)C2=C(C=CC=C2)C2=C1C=CC=C2 |
| CAS DataBase Reference | 161182-73-6(CAS DataBase Reference) |
Safety Information
9,9-Bis[4-(2-acryloyloxyethyloxy)phenyl]fluorene Usage And Synthesis
| Chemical Properties | 9,9-Bis[4-(2-acryloyloxyethyloxy)phenyl]fluorene is a monofunctional, monomeric and optical initiator. It is a bifunctional molecule that can polymerize with other molecules to form polyesters. |
| Uses | (((9H-Fluorene-9,9-diyl)bis(4,1-phenylene))bis(oxy))bis(ethane-2,1-diyl) diacrylate (CAS# 161182-73-6) is a photosensitive compound often found in film curing resins and solutions. |
| Application | 9,9-Bis[4-(2-acryloyloxyethyloxy)phenyl]fluorene is a optical initiator, it has been used for the study of liquid crystals as well. |
9,9-Bis[4-(2-acryloyloxyethyloxy)phenyl]fluorene Preparation Products And Raw materials