Introduction：Basic information about 9,9'-Bianthracene CAS 1055-23-8, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
9,9'-Bianthracene Basic informationPhysical Form
| Product Name: | 9,9'-Bianthracene |
| Synonyms: | 9-(9-Anthryl)anthracene;9,9’-bianthryl;9,9'-Bianthracenyl;9,9'-Bianthranyl;9,9'-Bianthryl;9,9'-Dianthracene;bianthracene;bianthryl |
| CAS: | 1055-23-8 |
| MF: | C28H18 |
| MW: | 354.44 |
| EINECS: | 1592732-453-0 |
| Product Categories: | Electronic Chemicals |
| Mol File: | 1055-23-8.mol |
|
9,9'-Bianthracene Chemical Properties
| Melting point | >300°C |
| Boiling point | 422.66°C (rough estimate) |
| density | 1.1633 (estimate) |
| refractive index | 1.8430 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| color | Light yellow to Yellow to Green |
| InChI | InChI=1S/C28H18/c1-5-13-23-19(9-1)17-20-10-2-6-14-24(20)27(23)28-25-15-7-3-11-21(25)18-22-12-4-8-16-26(22)28/h1-18H |
| InChIKey | SXGIRTCIFPJUEQ-UHFFFAOYSA-N |
| SMILES | C1=C2C(C=C3C(=C2C2C4=CC=CC=C4C=C4C=2C=CC=C4)C=CC=C3)=CC=C1 |
| CAS DataBase Reference | 1055-23-8(CAS DataBase Reference) |
| NIST Chemistry Reference | 9,9'-Bianthracene(1055-23-8) |
| EPA Substance Registry System | 9,9'-Bianthracene (1055-23-8) |
Safety Information
| Safety Statements | 22-24/25 |
| RTECS | DT3572500 |
| HS Code | 29029090 |
9,9'-Bianthracene Usage And Synthesis
| Physical Form | Solid |
| Uses | 9,9'-Bianthracene is a useful research chemical. |
9,9'-Bianthracene Preparation Products And Raw materials
