Introduction:Basic information about Aids004768 CAS 145986-07-8, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Aids004768 Basic information
| Product Name: | Aids004768 |
| Synonyms: | Lamivudine EP Impurity J;2,4(1H,3H)-Pyrimidinedione, 1-[2-(hydroxymethyl)-1,3-oxathiolan-5-yl]-, (2R-cis)-;Aids004768;Aids-004768;LaMivudine IMpurity J;(-)-(2R,5S)-1-[2-(Hydroxymethyl)-1,3-oxathiolan-5-yl]uracil;Lamivudine Impurity 10(Lamivudine EP Impurity J);1-(2-(Hydroxymethyl)-1,3-oxathiolan-5-yl)pyrimidine-2,4(1H,3H)-dione,(2R,5S)- |
| CAS: | 145986-07-8 |
| MF: | C8H10N2O4S |
| MW: | 230.24 |
| EINECS: | |
| Product Categories: | |
| Mol File: | 145986-07-8.mol |
|
Aids004768 Chemical Properties
| density | 1.521±0.06 g/cm3(Predicted) |
| storage temp. | -10 to -25°C |
| pka | 9.27±0.10(Predicted) |
| Major Application | pharmaceutical |
| InChI | 1S/C8H10N2O4S/c11-3-7-14-6(4-15-7)10-2-1-5(12)9-8(10)13/h1-2,6-7,11H,3-4H2,(H,9,12,13)/t6-,7+/m0/s1 |
| InChIKey | BNVOMPQTQUUYHU-NKWVEPMBSA-N |
| SMILES | S1[C@@H](O[C@@H](C1)N2C=CC(=O)NC2=O)CO |
Safety Information
| WGK Germany | WGK 3 |
| Storage Class | 13 - Non Combustible Solids |
Aids004768 Usage And Synthesis
| Uses | (2R-cis)-1-[2-(Hydroxymethyl)-1,3-oxathiolan-5-yl]-2,4(1H,3H)-pyrimidinedione (Lamivudine EP Impurity J) is an impurity of Lamivudine (L172500). (2R-cis)-1-[2-(Hydroxymethyl)-1,3-oxathiolan-5-yl]-2,4(1H,3H)-pyrimidinedione is also being further studied to determine its potential as an anti-HIV agent. |
Aids004768 Preparation Products And Raw materials