Introduction：Basic information about ALEURITIC ACID CAS 533-87-9, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
ALEURITIC ACID Basic information
| Product Name: | ALEURITIC ACID |
| Synonyms: | 8,9,15-trihydroxypentadecane-1-carboxylicacid;9,10,16-trihydroxy-,(r*,s*)-(+-)-hexadecanoicaci;9,10,16-trihydroxy-,(R*,S*)-(±)-Hexadecanoicacid;9,10,16-trihydroxy-,(theta,s)-(+/-)-hexadecanoicaci;aleuriticacid,tech.;alpha-aleuriticacid;DL-erythro-9,10,16-Trihydroxyhexadecanoic acid;dl-erythro-9,10,16-trihydroxyhexadecanoicacid |
| CAS: | 533-87-9 |
| MF: | C16H32O5 |
| MW: | 304.42 |
| EINECS: | 208-578-8 |
| Product Categories: | Building Blocks;C13 to C42+;Carbonyl Compounds;Carboxylic Acids;Chemical Synthesis;Organic Building Blocks;Fatty & Aliphatic Acids, Esters, Alcohols & Derivatives;Inhibitors |
| Mol File: | 533-87-9.mol |
|
ALEURITIC ACID Chemical Properties
| Melting point | 100-101 °C(lit.) |
| Boiling point | 365.24°C (rough estimate) |
| density | 1.085 |
| refractive index | 1.6200 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly, Heated), DMSO (Slightly), Ethyl Acetate (Slightly, Heated） |
| pka | 4.78±0.10(Predicted) |
| form | Crystalline Powder |
| color | White to beige |
| Water Solubility | Soluble in water, alcohol, acetic acid and acetone. |
| Merck | 14,231 |
| BRN | 1727724 |
| Stability: | Hygroscopic |
| Major Application | pharmaceutical small molecule |
| InChI | 1S/C16H32O5/c17-13-9-5-4-7-11-15(19)14(18)10-6-2-1-3-8-12-16(20)21/h14-15,17-19H,1-13H2,(H,20,21)/t14-,15+/m1/s1 |
| InChIKey | MEHUJCGAYMDLEL-CABCVRRESA-N |
| SMILES | OCCCCCC[C@H](O)[C@H](O)CCCCCCCC(O)=O |
| LogP | 2.830 |
| CAS DataBase Reference | 533-87-9(CAS DataBase Reference) |
| EPA Substance Registry System | .alpha.-Aleuritic acid (533-87-9) |
Safety Information
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| RTECS | ML9850000 |
| TSCA | TSCA listed |
| HS Code | 29181998 |
| Storage Class | 11 - Combustible Solids |
ALEURITIC ACID Usage And Synthesis
| Chemical Properties | white to beige crystalline powder |
| Uses | α-Aleuritic acid is a major ingredient of shellac and is also a starting reagent in the manufacture of perfumes. |
| Purification Methods | Crystallise the acid from aqueous EtOH. The hydrazide crystallises from EtOH and has m 139-140o. [Beilstein 3 III 901.] |
ALEURITIC ACID Preparation Products And Raw materials
