Introduction：Basic information about alpha-Dihydroartemisinin CAS 81496-81-3, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
alpha-Dihydroartemisinin Basic information
| Product Name: | alpha-Dihydroartemisinin |
| Synonyms: | alpha-dihydroartemisinin;artenimol;dhqhs 1;(3R,5aS,6R,8aS,9R,10R,12R,12aR)-Decahydro-3,6,9-trimethyl-3,12-epoxy-12H-pyrano[4,3-j]-1,2-benzodioxepin-10-ol;Artenimol [inn];BDIH;DihydroarteMisinin (α,β Mixture);dihdyroartesiminin |
| CAS: | 81496-81-3 |
| MF: | C15H24O5 |
| MW: | 284.35 |
| EINECS: | 617-239-7 |
| Product Categories: | API |
| Mol File: | 81496-81-3.mol |
|
alpha-Dihydroartemisinin Chemical Properties
| Melting point | 142-144°C |
| Boiling point | 375.6±42.0 °C(Predicted) |
| density | 1.24±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), DMSO (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 12.61±0.70(Predicted) |
| color | White to Off-White |
| InChI | InChI=1S/C15H24O5/c1-8-4-5-11-9(2)12(16)17-13-15(11)10(8)6-7-14(3,18-13)19-20-15/h8-13,16H,4-7H2,1-3H3/t8-,9-,10+,11+,12-,13-,14-,15-/m1/s1 |
| InChIKey | BJDCWCLMFKKGEE-KDTBHNEXSA-N |
| SMILES | O1[C@]23[C@@]4([H])O[C@@](C)(CC[C@@]2([H])[C@H](C)CC[C@@]3([H])[C@@H](C)[C@H](O)O4)O1 |
Safety Information
alpha-Dihydroartemisinin Usage And Synthesis
| Chemical Properties | White needle like crystal |
| Uses | antimalarial, antiinflammatory |
| Definition | ChEBI: Dihydroartemisinin (DHA) is an artemisinin derivative. |
| target | Antifection |
alpha-Dihydroartemisinin Preparation Products And Raw materials
| Raw materials | DHQHS 2-->Artemisinin |
| Preparation Products | (3R,12aR)-3,6α,9β-Trimethyl-3β,12α-epoxy-3,4,5,5aα,6,7,8,8aα,9,10-decahydro-10α-ethoxypyrano[4,3-j]-1,2-benzodioxepin-->Arteether-->Artesunate |
