ANTHRACENE-D10 CAS 1719-06-8
Introduction：Basic information about ANTHRACENE-D10 CAS 1719-06-8, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
ANTHRACENE-D10 Basic information
| Product Name: | ANTHRACENE-D10 |
| Synonyms: | ANTHRACENE-D10;Anthracene. perdeutero-;[2H10]anthracene;ANTHRACENE-D10, 1X1ML, CH2CL2, 2000UG/ML;ANTHRACENE-D10, 100MG, NEAT;Anthracene-1,2,3,4,5,6,7,8,9,10-d10;ANTHRACENE-D10, 98 ATOM % D;Anthracene-d10, 98+ atom% D, for NMR |
| CAS: | 1719-06-8 |
| MF: | C14D10 |
| MW: | 188.29 |
| EINECS: | 217-004-5 |
| Product Categories: | A;A-BAlphabetic;Alpha Sort;AM to AQ;Volatiles/ Semivolatiles;AM to AQEPA;600 Series Wastewater Methods;Method 625;Alphabetical Listings;Stable Isotopes |
| Mol File: | 1719-06-8.mol |
ANTHRACENE-D10 Chemical Properties
| Melting point | 210-215 °C (lit.) |
| Boiling point | 340 °C (lit.) |
| Fp | 121 °C |
| storage temp. | 2-8°C |
| solubility | Chloroform (Sparingly), Ethyl Acetate (Slightly), Methanol (Slightly, Heated and Sonicated) |
| form | Solid |
| color | White to off-white |
| BRN | 2055675 |
| Major Application | electronics |
| InChI | InChI=1S/C14H10/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1/h1-10H/i1D,2D,3D,4D,5D,6D,7D,8D,9D,10D |
| InChIKey | MWPLVEDNUUSJAV-LHNTUAQVSA-N |
| SMILES | C12C([2H])=C([2H])C([2H])=C([2H])C=1C([2H])=C1C([2H])=C([2H])C([2H])=C([2H])C1=C2[2H] |
| CAS DataBase Reference | 1719-06-8(CAS DataBase Reference) |
| EPA Substance Registry System | Anthracene-d10 (1719-06-8) |
| CAS Number Unlabeled | 120-12-7 |
Safety Information
| Hazard Codes | Xi,N,T,Xn |
| Risk Statements | 36/37/38-50/53-63-43-23/24/25-45-67-52/53-40 |
| Safety Statements | 26-60-61-36/37-24/25-23-53 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 2 |
| F | 10-21 |
| HS Code | 28459000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Eye Irrit. 2 |
| Chemical Properties | beige-yellow powder |
| Uses | May be used as an analytical standard |
ANTHRACENE-D10 Preparation Products And Raw materials
| Raw materials | Anthracene |
