Introduction：Basic information about APIIN CAS 26544-34-3, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
APIIN Basic information
| Product Name: | APIIN |
| Synonyms: | 4H-1-BENZOPYRAN-4-ONE,7-[(2-O-D-APIO-BETA-D-FURANOSYL-BETA-D-GLUCOPYRANOSYL)OXY]-5-HYDROXY-2-(4-HYDROXYPHENYL)-;7-(2-APIOSYLGLUCOSYL)APIGENIN;APIIN:4H-1-BENZOPYRAN-4-ONE,7-[(2-O-D-APIO--D-FURANOSYL--D-GLUCOPYRANOSYL)OXY]-5-HYDROXY-2-(4-HYDROXYPHENYL)-,;4H-1-Benzopyran-4-one,7-[(2-O-D-apio-β-D;-furanosyl-β-D-glucopyranosyl)oxy]-5-hydroxy-2-;7-[(2-O-D-Apio-β-D-furanosyl-β-D-glucopyranosyl)oxy]-5-hydroxy-2-(4-hydroxyphenyl)-4H-1-benzopyran-4-one;APIIN;APIOSIDE |
| CAS: | 26544-34-3 |
| MF: | C26H28O14 |
| MW: | 564.49 |
| EINECS: | 247-780-0 |
| Product Categories: | chemical reagent;pharmaceutical intermediate;phytochemical;reference standards from Chinese medicinal herbs (TCM).;standardized herbal extract;Tri-substituted Flavones |
| Mol File: | 26544-34-3.mol |
|
APIIN Chemical Properties
| Melting point | 230°C (dec.) |
| Boiling point | 942.2±65.0 °C(Predicted) |
| density | 1.74±0.1 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly, Sonicated) |
| form | Solid |
| pka | 6.11±0.40(Predicted) |
| color | Pale Yellow |
| Stability: | Hygroscopic |
| Major Application | food and beverages |
| InChIKey | NTDLXWMIWOECHG-MFMSCHSJSA-N |
| SMILES | OC[C@H]1O[C@@H](Oc2cc(O)c3C(=O)C=C(Oc3c2)c4ccc(O)cc4)[C@H](O[C@@H]5OC[C@](O)(CO)[C@@H]5O)[C@@H](O)[C@@H]1O |
| LogP | 0.720 (est) |
Safety Information
| WGK Germany | 1 |
| F | 3-10 |
| HS Code | 29389090 |
| Storage Class | 11 - Combustible Solids |
APIIN Usage And Synthesis
| Chemical Properties | Yellow crystal, soluble in methanol, ethanol, DMSO and other organic solvents, from celery seed, noble spring yellow chrysanthemum Anthemis nobilis, dry parsley Apium graveolens, Matricaria chamomilla [Syn. Matricaria recuJita], small nesting vegetable ircia hirsuta, parsley with crumpled leaves. |
| Uses | Apiin is an extract flavonoid compound from parsley which shows inhibition towards viral neuramindase. It also shows antiproliferative and apoptotic effects towards human cancer cells. |
| Definition | ChEBI: A beta-D-glucoside having a beta-D-apiosyl residue at the 2-position and a 5,4'-dihydroxyflavon-7-yl moiety at the anomeric position. |
| Biological Activity | Apiin, a major flavonoid component of celery, shows antiinflammatory activity mediated through inhibition of nitric oxide synthesis and inhibition of iNOS expression. |
APIIN Preparation Products And Raw materials
