Introduction：Basic information about BENZYL-2,3,4,5,6-D5 BROMIDE CAS 71258-22-5, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Table of Contents
- 1. BENZYL-2,3,4,5,6-D5 BROMIDE Basic information
- 2. BENZYL-2,3,4,5,6-D5 BROMIDE Chemical Properties
- 3. Safety Information
- 4. BENZYL-2,3,4,5,6-D5 BROMIDE Usage And Synthesis
- 5. BENZYL-2,3,4,5,6-D5 BROMIDE Preparation Products And Raw materials
BENZYL-2,3,4,5,6-D5 BROMIDE Basic information
| Product Name: | BENZYL-2,3,4,5,6-D5 BROMIDE |
| Synonyms: | BENZYL-2,3,4,5,6-D5 BROMIDE;Benzyl-d5 BroMide;BENZYL BROMIDE(RING-D5, 98%);1-(Bromomethyl)benzene-2,3,4,5,6-d5;Benzyl bromide d5#;Phenylmethyl bromide-d5;Benzyl bromide (ring-D?, 98%) |
| CAS: | 71258-22-5 |
| MF: | C7H2BrD5 |
| MW: | 176.07 |
| EINECS: | |
| Product Categories: | Intermediates, Isotope Labelled Compounds |
| Mol File: | 71258-22-5.mol |
|
BENZYL-2,3,4,5,6-D5 BROMIDE Chemical Properties
| solubility | Acetone (Slightly), Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | Oil |
| color | Colourless to Dark Orange |
| InChI | InChI=1S/C7H7Br/c8-6-7-4-2-1-3-5-7/h1-5H,6H2/i1D,2D,3D,4D,5D |
| InChIKey | AGEZXYOZHKGVCM-RALIUCGRSA-N |
| SMILES | C1(CBr)C([2H])=C(C([2H])=C([2H])C=1[2H])[2H] |
| CAS Number Unlabeled | 71258-22-5 |
Safety Information
BENZYL-2,3,4,5,6-D5 BROMIDE Usage And Synthesis
| Uses | BENZYL-2,3,4,5,6-D5 BROMIDE is a compound used in organic synthesis for the introduction of the benzyl protecting group for alcohols and carboxylic acids. |
BENZYL-2,3,4,5,6-D5 BROMIDE Preparation Products And Raw materials
