Introduction:Basic information about CAS 182250-70-0|3,5-bis(tert-butyldiphenylsilyloxy)benzyl alcohol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3,5-bis(tert-butyldiphenylsilyloxy)benzyl alcohol |
|---|
| CAS Number | 182250-70-0 | Molecular Weight | 616.936 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 631.6±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C39H44O3Si2 | Melting Point | 108ºC |
|---|
| MSDS | / | Flash Point | 335.8±31.5 °C |
|---|
Names
| Name | [3,5-bis[[tert-butyl(diphenyl)silyl]oxy]phenyl]methanol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 631.6±55.0 °C at 760 mmHg |
|---|
| Melting Point | 108ºC |
|---|
| Molecular Formula | C39H44O3Si2 |
|---|
| Molecular Weight | 616.936 |
|---|
| Flash Point | 335.8±31.5 °C |
|---|
| Exact Mass | 616.282898 |
|---|
| PSA | 38.69000 |
|---|
| LogP | 12.81 |
|---|
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.603 |
|---|
| InChIKey | SDDISUZNVYXXHS-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)[Si](Oc1cc(CO)cc(O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)c1)(c1ccccc1)c1ccccc1 |
|---|
Synonyms
| Benzenemethanol, 3,5-bis[[(1,1-dimethylethyl)diphenylsilyl]oxy]- |
| MFCD02093440 |
| (3,5-Bis{[tert-butyl(diphenyl)silyl]oxy}phenyl)methanol |
| B2052 |
| (3,5-Bis{[(2-methyl-2-propanyl)(diphenyl)silyl]oxy}phenyl)methanol |
| 3,5-Bis(tert-butyldiphenylsilyloxy)benzyl Alcohol |
| 3,5-Di-tert-butyldiphenylsilyloxybenzylalcohol |