Introduction：Basic information about BENZYL-D7 BROMIDE CAS 35656-93-0, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
BENZYL-D7 BROMIDE Basic information
| Product Name: | BENZYL-D7 BROMIDE |
| Synonyms: | BENZYL-D7 BROMIDE;BENZYL-D7 BROMIDE, 98 ATOM % D;Benzene-d5, (bromomethyl-d2)-;benzyl bromide-d7;α-bromotoluene-d7;1-[bromo(dideuterio)methyl]-2,3,4,5,6-pentadeuteriobenzene;6-(Bromomethyl-d2)benzene-1,2,3,4,5-d5;(Bromomethyl-d2)benzene-d5 |
| CAS: | 35656-93-0 |
| MF: | C7BrD7 |
| MW: | 178.08 |
| EINECS: | |
| Product Categories: | |
| Mol File: | 35656-93-0.mol |
|
BENZYL-D7 BROMIDE Chemical Properties
| Melting point | −3-−1 °C(lit.) |
| Boiling point | 198-199 °C(lit.) |
| density | 1.497 g/mL at 25 °C |
| refractive index | n20/D 1.574(lit.) |
| Fp | 188 °F |
| InChI | InChI=1S/C7H7Br/c8-6-7-4-2-1-3-5-7/h1-5H,6H2/i1D,2D,3D,4D,5D,6D2 |
| InChIKey | AGEZXYOZHKGVCM-XZJKGWKKSA-N |
| SMILES | C1(C([2H])([2H])Br)C([2H])=C(C([2H])=C([2H])C=1[2H])[2H] |
Safety Information
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 1737 8(6.1) / PGII |
| WGK Germany | 3 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2
very toxic hazardous materials |
| Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
BENZYL-D7 BROMIDE Usage And Synthesis
| Uses | Benzyl-d7 Bromide is the isotope labelled analog of Benzyl Bromide (B233650) |
BENZYL-D7 BROMIDE Preparation Products And Raw materials
| Preparation Products | BENZYL-D7 ALCOHOL |
