beta-D-Galactose pentaacetate CAS 4163-60-4
Introduction:Basic information about beta-D-Galactose pentaacetate CAS 4163-60-4, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
beta-D-Galactose pentaacetate Basic information
| Product Name: | beta-D-Galactose pentaacetate |
| Synonyms: | Penta-O-acetyl-β-D-galactopyranose;beta-D-Galactose pen;Penta-O-acetyl-β-D-galactopyranose, 1,2,3,4,6-Penta-O-acetyl-β-D-galactopyranose;1,2,3,4,6-Penta-O-acetyl-β-D-galactopyranose, Penta-O-acetyl-β-D-galactopyranose;[(2S,3R,4S,5S,6R)-2,3,5-Triacetyloxy-6-(acetyloxymethyl)oxan-4-yl] acetate;D-Galactose pentaacetate ,98%;Acetyl 2-O,3-O,4-O,6-O-tetraacetyl-β-D-galactopyranoside;(2S,3R,4S,5S,6R)-6-(acetoxyMethyl)tetrahydro-2H-pyran-2,3,4,5-tetrayl tetraacetate |
| CAS: | 4163-60-4 |
| MF: | C16H22O11 |
| MW: | 390.34 |
| EINECS: | 224-008-0 |
| Product Categories: | Sugars, Carbohydrates & Glucosides;Biochemistry;Galactose;O-Substituted Sugars;Sugars;carbohydrate;Glycon Biochem;4163-60-4 |
| Mol File: | 4163-60-4.mol |
beta-D-Galactose pentaacetate Chemical Properties
| Melting point | 143-144 °C(lit.) |
| alpha | 25 º (c=10,CHCl3,on dry ba) |
| Boiling point | 435.58°C (rough estimate) |
| density | 1.3984 (rough estimate) |
| refractive index | 23.5 ° (C=2, MeOH) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | methanol: 50 mg/mL, clear |
| form | powder |
| color | White |
| Water Solubility | Soluble in methanol (50 mg/ml), chloroform, and water. |
| BRN | 98853 |
| InChI | InChI=1/C16H22O11/c1-7(17)22-6-12-13(23-8(2)18)14(24-9(3)19)15(25-10(4)20)16(27-12)26-11(5)21/h12-16H,6H2,1-5H3/t12-,13+,14+,15-,16-/s3 |
| InChIKey | LPTITAGPBXDDGR-FTTYHUIRNA-N |
| SMILES | [C@@H]1(OC(=O)C)[C@@H](OC(=O)C)[C@@H](O[C@H](COC(=O)C)[C@@H]1OC(=O)C)OC(=O)C |&1:0,5,10,12,18,r| |
| CAS DataBase Reference | 4163-60-4(CAS DataBase Reference) |
| EPA Substance Registry System | .beta.-D-Galactopyranose, pentaacetate (4163-60-4) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-36/37/39-27-26 |
| WGK Germany | 1 |
| TSCA | TSCA listed |
| HS Code | 29400000 |
| Storage Class | 11 - Combustible Solids |
| Chemical Properties | white fine crystalline powder |
| Uses | It is used as a pharmaceutical intermediates. |
beta-D-Galactose pentaacetate Preparation Products And Raw materials
| Raw materials | 3,4,6-Tri-O-acetyl-D-galactal-->.beta.-D-Galactopyranose-->D-glucose-->D-(+)-GALACTOSE-->Sodium acetate |
| Preparation Products | D-Galactal-->6-BROMO-2-NAPHTHYL-BETA-D-GALACTOPYRANOSIDE-->1-AZIDO-2,3,4,6-TETRA-O-ACETYL-BETA-D-GLUCOSE-->4-METHYLUMBELLIFERYL-ALPHA-D-GALACTOPYRANOSIDE-->1-NAPHTHYL-BETA-D-GALACTOPYRANOSIDE |
