Introduction：Basic information about Bis(8-quinolinolato) zinc CAS 13978-85-3, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Bis(8-quinolinolato) zinc Basic information
| Product Name: | Bis(8-quinolinolato) zinc |
| Synonyms: | o8)-bis(8-quinolinolato-n(beta-4)-zin;8-QUINOLINOL ZINC SALT;ZINC(II) BIS(8-HYDROXYQUINOLINATE);ZINC 8-HYDROXYQUINOLINATE;zinc 8-hydroxyquinoline;ZINC 8-QUINOLINOL;ZINC 8-QUINOLINOLATE;Bis(8-quinolinolato) zinc |
| CAS: | 13978-85-3 |
| MF: | C18H12N2O2Zn |
| MW: | 353.69 |
| EINECS: | 237-762-0 |
| Product Categories: | Classes of Metal Compounds;Electroluminescence;Functional Materials;Quinolinecarboxylic Acids, etc.;Quinolines;Transition Metal Compounds;electronic;Zn (Zinc) Compounds;1 |
| Mol File: | 13978-85-3.mol |
|
Bis(8-quinolinolato) zinc Chemical Properties
| Melting point | >350 °C (lit.) |
| form | powder to crystal |
| color | Yellow to Brown to Dark green |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| λmax | 255 nm |
| Solubility Product Constant (Ksp) | pKsp: 24.30 |
| InChI | 1S/2C9H7NO.Zn/c2*11-8-5-1-3-7-4-2-6-10-9(7)8;/h2*1-6,11H;/q;;+2/p-2 |
| InChIKey | HTPBWAPZAJWXKY-UHFFFAOYSA-L |
| SMILES | C[Zn](C)(Oc1cccc2cccnc12)Oc3cccc4cccnc34 |
| CAS DataBase Reference | 13978-85-3(CAS DataBase Reference) |
| NIST Chemistry Reference | bis(8-quinolinolato-N1,O8)zinc(13978-85-3) |
| EPA Substance Registry System | Zinc 8-quinolinolate (13978-85-3) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29334900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
Bis(8-quinolinolato) zinc Usage And Synthesis
| Chemical Properties | Yellow powder |
| Uses | Bis(8-quinolinolato-N1,O8)-zinc(II) complex (Znq2) can be employed as an electron transfer layer in organic light-emitting diodes. |
| General Description | Bis(8-hydroxyquinoline) zinc(II) complex (Znq2), an electroluminescent material. |
Bis(8-quinolinolato) zinc Preparation Products And Raw materials
