Introduction:Basic information about BOC-D-2-THIENYLALANINE CAS 78452-55-8, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
BOC-D-2-THIENYLALANINE Basic information
| Product Name: | BOC-D-2-THIENYLALANINE |
| Synonyms: | N-(tert-Butoxycarbonyl)-3-(2-thienyl)-D-alanine;(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-thiophen-2-ylpropanoate;BOC-3-D-ALA(2-THIENYL)-OH;BOC-BETA-(2-THIENYL)-D-ALANINE;BOC-D-ALA(2-THIENYL)-OH;BOC-D-2-THIENYLALANINE;BOC-D-THI-OH;BOC-3-(2-THIENYL)-D-ALANINE;;BOC-D-2-THI;(2R)-2-[[(2-methylpropan-2-yl)oxy-oxomethyl]amino]-3-thiophen-2-ylpropanoate;(R)-N-BOC-2-THIENYLALANINE, 95%, 98% EE;(R)-N-BOC-2-ThienylalanineN-tert-Butoxycarbonyl-2-thienyl-D-alanine;(2R)-2-{[(tert-butoxy)carbonyl]aMino}-3-(thiophen-2-yl)propanoic acid |
| CAS: | 78452-55-8 |
| MF: | C12H17NO4S |
| MW: | 271.33 |
| EINECS: | |
| Product Categories: | a-amino;Phenylalanine analogs and other aromatic alpha amino acids;Amino Acids |
| Mol File: | 78452-55-8.mol |
|
BOC-D-2-THIENYLALANINE Chemical Properties
| Boiling point | 431.5±40.0 °C(Predicted) |
| density | 1.2791 (rough estimate) |
| refractive index | 1.6280 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,2-8°C |
| pka | 3.70±0.10(Predicted) |
| Major Application | peptide synthesis |
| InChI | InChI=1/C12H17NO4S/c1-12(2,3)17-11(16)13-9(10(14)15)7-8-5-4-6-18-8/h4-6,9H,7H2,1-3H3,(H,13,16)(H,14,15)/t9-/s3 |
| InChIKey | OJLISTAWQHSIHL-DJEYLCQNNA-N |
| SMILES | [C@@H](C(=O)O)(NC(=O)OC(C)(C)C)CC1SC=CC=1 |&1:0,r| |
| CAS DataBase Reference | 78452-55-8(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29223900 |
| Storage Class | 11 - Combustible Solids |
BOC-D-2-THIENYLALANINE Usage And Synthesis
| Chemical Properties | off-white to beige crystalline powder |
| Uses | (R)-N-Boc-2-Thienylalanine, is an alanine derivative, used in various chemical synthesis and peptide chemistry. |
| reaction suitability | reaction type: Boc solid-phase peptide synthesis |
BOC-D-2-THIENYLALANINE Preparation Products And Raw materials