Introduction：Basic information about BOC-L-4-Trifluoromethylphe CAS 114873-07-3, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
BOC-L-4-Trifluoromethylphe Basic information
| Product Name: | BOC-L-4-Trifluoromethylphe |
| Synonyms: | N-BOC-4-(TRIFLUOROMETHYL)-L-PHENYLALANINE;4-(TRIFLUOROMETHYL)-L-PHENYLALANINE, BOC PROTECTED;L-4-(TRIFLUOROMETHYL)PHENYLALANINE, BOC PROTECTED;BOC-PHE(4-CF 3)-OH;BOC-L-PHE(4-TRIFLUOROMETHYL)-OH;BOC-4-(TRIFLUOROMETHYL)-L-PHENYLALANINE;BOC-L-4-TRIFLUOROMETHYLPHE;BOC-L-4-TRIFLUOROMETHYLPHENYLALANINE |
| CAS: | 114873-07-3 |
| MF: | C15H18F3NO4 |
| MW: | 333.3 |
| EINECS: | |
| Product Categories: | Phenylalanine analogs and other aromatic alpha amino acids;Amino Acid Derivatives;a-amino;Amino Acids |
| Mol File: | 114873-07-3.mol |
|
BOC-L-4-Trifluoromethylphe Chemical Properties
| Melting point | 118-137°C |
| Boiling point | 431.4±45.0 °C(Predicted) |
| density | 1.271±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 3.76±0.10(Predicted) |
| form | powder to crystal |
| color | White to Almost white |
| Optical Rotation | [α]20/D +5.4±0.7°, c = 1% in methanol |
| BRN | 5617499 |
| Major Application | peptide synthesis |
| InChI | 1S/C15H18F3NO4/c1-14(2,3)23-13(22)19-11(12(20)21)8-9-4-6-10(7-5-9)15(16,17)18/h4-7,11H,8H2,1-3H3,(H,19,22)(H,20,21)/t11-/m0/s1 |
| InChIKey | SMVCCWNHCHCWAZ-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1ccc(cc1)C(F)(F)F)C(O)=O |
| CAS DataBase Reference | 114873-07-3(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| WGK Germany | 3 |
| Hazard Note | Harmful/Irritant/Keep Cold |
| HS Code | 2924297099 |
| Storage Class | 13 - Non Combustible Solids |
BOC-L-4-Trifluoromethylphe Usage And Synthesis
| Uses | N-(tert-Butoxycarbonyl)-4-trifluoromethyl-L-phenylalanine is a useful pharmaceutical intermediate. It is used in the preparation of ring substituted phenylalanines and tryptophans. Also Used in the preparation of proline derivatives with inhibitory action against dipeptidyl peptidase IV. |
| reaction suitability | reaction type: Boc solid-phase peptide synthesis |
BOC-L-4-Trifluoromethylphe Preparation Products And Raw materials
