Introduction:Basic information about Boc-N-alpha-methyl-O-benzyl-L-tyrosine CAS 64263-81-6, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Boc-N-alpha-methyl-O-benzyl-L-tyrosine Basic information
| Product Name: | Boc-N-alpha-methyl-O-benzyl-L-tyrosine |
| Synonyms: | BOC-N-ME-TYROSINE(BZL)-OH;BOC-N-METHYL-O-BENZYL-L-TYROSINE;BOC-L-METYR(BZL)-OH;BOC-N-ALPHA-METHYL-O-BENZYL-L-TYROSINE;BOC-METYR(BZL)-OH;N-ALPHA-1-BUTOXYCARBONYL-N-ALPHA-METHYL-O-BENZYL-L-TYROSINE;N-ALPHA-BOC-O-BENZYL-N-ALPHA-METHYL-L-TYROSINE;N-ALPHA-T-BOC-N-ALPHA-METHYL-O-BENZYL-L-TYROSINE |
| CAS: | 64263-81-6 |
| MF: | C22H27NO5 |
| MW: | 385.45 |
| EINECS: | |
| Product Categories: | amino acids;Tyrosine [Tyr, Y];N-Methyl Amino Acids;Boc-Amino acid series |
| Mol File: | 64263-81-6.mol |
|
Boc-N-alpha-methyl-O-benzyl-L-tyrosine Chemical Properties
| Melting point | 130-134 °C |
| Boiling point | 533.0±50.0 °C(Predicted) |
| density | 1.174±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | Powder |
| pka | 3.00±0.10(Predicted) |
| InChI | InChI=1S/C22H27NO5/c1-22(2,3)28-21(26)23(4)19(20(24)25)14-16-10-12-18(13-11-16)27-15-17-8-6-5-7-9-17/h5-13,19H,14-15H2,1-4H3,(H,24,25)/t19-/m0/s1 |
| InChIKey | FSNRGORPOYPIJC-IBGZPJMESA-N |
| SMILES | C(O)(=O)[C@H](CC1=CC=C(OCC2=CC=CC=C2)C=C1)N(C(OC(C)(C)C)=O)C |
| CAS DataBase Reference | 64263-81-6(CAS DataBase Reference) |
Safety Information
| WGK Germany | 3 |
| HazardClass | IRRITANT |
Boc-N-alpha-methyl-O-benzyl-L-tyrosine Usage And Synthesis
| Chemical Properties | White to off-white powder |
| Uses | Boc-N-methyl-O-benzyl-L-tyrosine is used in total synthesis of marine-derived elastase inhibitor lyngbyastatin 7, and its evaluation of in vitro antiproteolytic activity against porcine pancreatic elastase as reactant/reagent. |
Boc-N-alpha-methyl-O-benzyl-L-tyrosine Preparation Products And Raw materials