Introduction:Basic information about CAS 183742-23-6|N-4-Boc-N-1-Fmoc-2-piperazine carboxylic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-4-Boc-N-1-Fmoc-2-piperazine carboxylic acid |
|---|
| CAS Number | 183742-23-6 | Molecular Weight | 452.500 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 624.4±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C25H28N2O6 | Melting Point | 163ºC |
|---|
| MSDS | / | Flash Point | 331.4±31.5 °C |
|---|
Names
| Name | 1-(9H-fluoren-9-ylmethoxycarbonyl)-4-[(2-methylpropan-2-yl)oxycarbonyl]piperazine-2-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 624.4±55.0 °C at 760 mmHg |
|---|
| Melting Point | 163ºC |
|---|
| Molecular Formula | C25H28N2O6 |
|---|
| Molecular Weight | 452.500 |
|---|
| Flash Point | 331.4±31.5 °C |
|---|
| Exact Mass | 452.194733 |
|---|
| PSA | 96.38000 |
|---|
| LogP | 3.83 |
|---|
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.597 |
|---|
| InChIKey | QXTDDEUDYKMSQN-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=O)OCC2c3ccccc3-c3ccccc32)C(C(=O)O)C1 |
|---|
Safety Information
| Hazard Codes | Xn: Harmful; |
|---|
| Risk Phrases | R20/21/22;R36/37/38 |
|---|
| Safety Phrases | S22-S26-S36/37/39 |
|---|
Synonyms
| (+/-)-Phoracantholide |
| phorocantholide I |
| 4-Boc-1-Fmoc-piperazine-2-carboxylic acid |
| 1-[(9H-Fluoren-9-ylmethoxy)carbonyl]-4-{[(2-methyl-2-propanyl)oxy]carbonyl}-2-piperazinecarboxylic acid |
| phoracantholide I (+/-decan-9-olide) |
| 4-(tert-Butoxycarbonyl)-1-[(9H-fluoren-9-ylmethoxy)carbonyl]piperazine-2-carboxylic acid |
| dl-phoracantholide I |
| 10-Methyloxacyclodecan-2-one |
| 2-Oxecanone,10-methyl |
| (+/-)-phoracantholid I |
| 1,2,4-Piperazinetricarboxylic acid, 4-(1,1-dimethylethyl) 1-(9H-fluoren-9-ylmethyl) ester |
| MFCD01076311 |
| 10-Methyl-2-oxecanone |
| (+/-)-phoracantholide I |
| N-4-Boc-N-1-Fmoc-2-piperazine carboxylic acid |
| 5-hydroxy-6-methoxyflavanone (pinostrobin) |
| 10-methyl-oxecan-2-one |
| 4-Boc-1-Fmoc-2-piperazinecarboxylic acid |
| (+/-)-5-hydroxy-7-methoxyflavanone |
| (+/-)-pinostrobin |
| 5-hydroxy-7-methoxy-2-phenyl-chroman-4-one |
| Piperazine-1,2,4-tricarboxylic acid 4-tert-butyl ester 1-(9H-fluoren-9-ylmethyl)-ester |