Introduction:Basic information about Bromaminic acid CAS 116-81-4, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Bromaminic acid Basic information
| Product Name: | Bromaminic acid |
| Synonyms: | 4-Bromo-1-aminoanthraquinone-2-sulfonicacid;BRONAMINE ACID;BROMOAMINE ACID;BROMAMINE ACID;BROMAMINIC ACID;1-AMINO-4-BROMOANTHRAQUINONE-2-SULPHONIC ACID;1-AMINO-4-BROMO-9,10-DIOXO-9,10-DIHYDRO-ANTHRACENE-2-SULFONIC ACID;1-Amino-4-bromo-9,10-dioxoanthracene-2-sulphonic acid |
| CAS: | 116-81-4 |
| MF: | C14H8BrNO5S |
| MW: | 382.19 |
| EINECS: | 204-159-9 |
| Product Categories: | ketone;Intermediates of Dyes and Pigments |
| Mol File: | 116-81-4.mol |
|
Bromaminic acid Chemical Properties
| Melting point | ca 280℃ |
| density | 1.908±0.06 g/cm3(Predicted) |
| form | powder |
| pka | -1.56±0.20(Predicted) |
| color | Red |
| Odor | Odorless |
| InChIKey | TXMRAEGWZZVGIH-UHFFFAOYSA-M |
| SMILES | [Na+].NC1=C(C=C(Br)C2=C1C(=O)C1=CC=CC=C1C2=O)S([O-])(=O)=O |
| CAS DataBase Reference | 116-81-4(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Anthracenesulfonic acid, 1-amino-4-bromo-9,10-dihydro-9,10-dioxo- (116-81-4) |
Safety Information
Bromaminic acid Usage And Synthesis
| Uses | 1-Amino-4-bromoanthraquinone-2-sulfonic acid (bromamine acid) [CAS: 116-81-4] is the most important intermediate for manufacturing reactive and acid dyes. |
| Uses | Bromaminic acid is used as a dye. |
Bromaminic acid Preparation Products And Raw materials
| Raw materials | Bromine-->FUMING SULFURIC ACID-->Chlorosulfonic acid-->1-Aminoanthraquinone-->2-Bromoanthraquinone-->1-amino-9,10-dihydro-9,10-dioxoanthracene-2-sulphonic acid |
| Preparation Products | REACTIVE BLUE 4-->REACTIVE BLUE 19-->REACTIVE BLUE 5-->Reactive Blue 74-->Acid Blue 129-->ACID BLUE 25-->ACID BLUE 62-->C.I. Reactive Blue 1-->LANASOLBLUE3R-->Disperse Red 86-->Acid Blue 277-->Acid Blue 264-->Reactive Blue 49-->Reactive Brilliant Blue M-BR-->Acid Blue BGL-->ACID BLUE 41-->sodium 1-amino-4-[(4-butylphenyl)amino]-9,10-dihydro-9,10-dioxoanthracene-2-sulphonate-->disodium 4,4'-[methylenebis(4,1-phenyleneimino)]bis[1-amino-9,10-dihydro-9,10-dioxoanthracene-2-sulphonate]-->2-[(4-amino-9,10-dihydro-9,10-dioxo-3-sulfo-1-anthracenyl) amino]-4-[[2-(sulfooxy)ethyl]sulfonyl]-Benzoic acid-->Acid Violet 48-->Acid Violet 48 |