Bromophos CAS 2104-96-3
Introduction：Basic information about Bromophos CAS 2104-96-3, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Bromophos Basic information
| Product Name: | Bromophos |
| Synonyms: | Bromophos Standard;(4-bromo-2,5-dichloro-phenoxy)-dimethoxy-sulfanylidene-$l^{5}-phosphane;(4-bromo-2,5-dichlorophenoxy)-dimethoxy-sulfanylidene-$l^{5}-phosphane;(4-bromo-2,5-dichloro-phenoxy)-dimethoxy-thioxo-phosphorane;o-(4-bromo-2,5-dichlorophenyl) o,o-dimethyl ester;Bromophos methyl 50mg [2104-96-3];Bromophos Solution, 100ppm;Bromophos-methyl Standard |
| CAS: | 2104-96-3 |
| MF: | C8H8BrCl2O3PS |
| MW: | 366 |
| EINECS: | 218-277-3 |
| Product Categories: | BI - BZEnvironmental Standards;A-BPesticides&Metabolites;AcaricidesAlphabetic;Alpha sort;B;Insecticides;MetabolitesPesticides;Organophorous;Pesticides;Pesticides&Metabolites |
| Mol File: | 2104-96-3.mol |
Bromophos Chemical Properties
| Melting point | 53-56 °C |
| Boiling point | bp0.01 140-142° |
| density | 1.704±0.06 g/cm3(Predicted) |
| Fp | >100 °C |
| storage temp. | 0-6°C |
| form | solid |
| Water Solubility | 40mg/L(room temperature) |
| BRN | 1988276 |
| Major Application | agriculture environmental |
| InChI | 1S/C8H8BrCl2O3PS/c1-12-15(16,13-2)14-8-4-6(10)5(9)3-7(8)11/h3-4H,1-2H3 |
| InChIKey | NYQDCVLCJXRDSK-UHFFFAOYSA-N |
| SMILES | COP(=S)(OC)Oc1cc(Cl)c(Br)cc1Cl |
| CAS DataBase Reference | 2104-96-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Bromophos(2104-96-3) |
| EPA Substance Registry System | Bromophos (2104-96-3) |
Safety Information
| Hazard Codes | Xn;N,N,Xn |
| Risk Statements | 22-50/53 |
| Safety Statements | 2-36-60-61-46 |
| RIDADR | UN3077 9/PG 3 |
| WGK Germany | 3 |
| RTECS | TE7175000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 |
| Hazardous Substances Data | 2104-96-3(Hazardous Substances Data) |
| Toxicity | LD50 in male, female rats (mg/kg): 1600, 1730 orally (Gaines) |
| Uses | Bromophos is a pesticide residue that has been found in plants from Southeast Asia. |
| Definition | ChEBI: Bromofos is an organic thiophosphate. |
Bromophos Preparation Products And Raw materials
