Introduction：Basic information about Bromopropylate CAS 18181-80-1, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Bromopropylate Basic information
| Product Name: | Bromopropylate |
| Synonyms: | 4-Bromo-alpha-(4-bromophenyl)-alpha-hydroxybenzeneacetic acid 1-methylethyl ester;ACAROL;ACAROL (TM);Bromopropylate Solution, 1000ppm;BROMPROPYLAT;BROMPROPYLATE;4-bromo-alpha-(4-bromophenyl)-alpha-hydroxy-benzeneaceticaci1-methylethyl;4-bromo-alpha-(4-bromophenyl)-alpha-hydroxybenzeneaceticacid1-methylethyl |
| CAS: | 18181-80-1 |
| MF: | C17H16Br2O3 |
| MW: | 428.12 |
| EINECS: | 242-070-7 |
| Product Categories: | |
| Mol File: | 18181-80-1.mol |
|
Bromopropylate Chemical Properties
| Melting point | 77° |
| Boiling point | 504°C (rough estimate) |
| density | 1.5582 (rough estimate) |
| refractive index | 1.6010 (estimate) |
| Fp | >100 °C |
| storage temp. | 0-6°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 11.18±0.29(Predicted) |
| color | White to Off-White |
| Water Solubility | <0.5mg/L(20 ºC) |
| BRN | 2152560 |
| Major Application | agriculture
environmental |
| InChI | 1S/C17H16Br2O3/c1-11(2)22-16(20)17(21,12-3-7-14(18)8-4-12)13-5-9-15(19)10-6-13/h3-11,21H,1-2H3 |
| InChIKey | FOANIXZHAMJWOI-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)C(O)(c1ccc(Br)cc1)c2ccc(Br)cc2 |
| CAS DataBase Reference | 18181-80-1(CAS DataBase Reference) |
| NIST Chemistry Reference | Bromopropylate(18181-80-1) |
| EPA Substance Registry System | Bromopropylate (18181-80-1) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 38 |
| WGK Germany | 2 |
| RTECS | DD2100000 |
| HS Code | 29181990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1
Aquatic Chronic 1 |
| Hazardous Substances Data | 18181-80-1(Hazardous Substances Data) |
| Toxicity | LD50 orally in rats: 5000 mg/kg (Kenaga, Allison) |
Bromopropylate Usage And Synthesis
| Chemical Properties | White crystal. Melting point 77℃, relative density 1.59, vapor pressure 1.066×10-5Pa (20℃), 0.7Pa (100℃). Soluble in acetone, benzene, isopropyl alcohol, methanol, xylene and other organic solvents; solubility in water at 20 ℃ <0.5mg/kg. stable in storage at room temperature, stable in neutral medium, unstable in acidic or alkaline conditions. |
| Uses | Bromopropylate is a chemical compound used as an acaricide against spider mites in apiaries and on fruit crops such as citrus and grapes. |
| Uses | Acaricide. |
Bromopropylate Preparation Products And Raw materials
| Raw materials | Benzilic acid |
