cataCXium A-Pd-G2 CAS 1375477-29-4
Introduction：Basic information about cataCXium A-Pd-G2 CAS 1375477-29-4, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
cataCXium A-Pd-G2 Basic information
| Product Name: | cataCXium A-Pd-G2 |
| Synonyms: | cataCXium A-Pd-G2;2nd Gen. precatalyst cataCXium;Chloro[(di(1-adamantyl)-N-butylphosphine)-2-(2-aminobiphenyl)]palladium(II);cataCXium(R) A Pd G2;[2'-(Amino)[1,1'-biphenyl]-2-yl][butylbis(tricyclo[3.3.1.1(3,7)]dec-1-yl)phosphine]chloropalladium;Chloro[(di(1-adamantyl)-N-butylphosphine)-2-(2-aminobiphenyl)]palladium(II) / CataCXium A-Pd-G2;Palladium, [2'-(amino-κN)[1,1'-biphenyl]-2-yl-κC][butylbis(tricyclo[3.3.1.13,7]dec-1-yl)phosphine]chloro-;Chloro[(di(1-adamantyl)-N-butylphosphine)-2-(2-aminobiphenyl... |
| CAS: | 1375477-29-4 |
| MF: | C36H49ClNPPd |
| MW: | 668.64 |
| EINECS: | |
| Product Categories: | |
| Mol File: | 1375477-29-4.mol |
cataCXium A-Pd-G2 Chemical Properties
| Melting point | 220°C (decomposition) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| form | solid |
| InChIKey | ACPPOLPZSAKAJG-UHFFFAOYSA-N |
| SMILES | P([Pd+2]1(NC2=CC=CC=C2C2=CC=CC=[C-]12)[Cl-])(C12CC3CC(CC(C3)C1)C2)(C12CC3CC(CC(C3)C1)C2)CCCC |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Uses | Chloro[(di(1-adamantyl)-N-butylphosphine)-2-(2-aminobiphenyl)]palladium(II) is a Buchwald′s second generation catalyst that can be used as a palladium source for the coupling of potassium 1-(benzyloxy)alkyltrifluoroborates with aryl and heteroaryl chlorides via Suzuki-Miyaura reaction to yield protected secondary alcohols. |
| Uses | cataCXium? A Pd G2 is a Buchwald′s second generation catalyst that can be used as a palladium source for the coupling of potassium 1-(benzyloxy)alkyltrifluoroborates with aryl and heteroaryl chlorides via Suzuki-Miyaura reaction to yield protected secondary alcohols. |
| reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction reaction type: Heck Reaction reaction type: Hiyama Coupling reaction type: Negishi Coupling reaction type: Sonogashira Coupling reaction type: Stille Coupling reaction type: Suzuki-Miyaura Coupling reagent type: catalyst reaction type: Cross Couplings |
cataCXium A-Pd-G2 Preparation Products And Raw materials
