Introduction:Basic information about Catocene CAS 37206-42-1, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Catocene Basic information
| Product Name: | Catocene |
| Synonyms: | BEFP;2,2-BIS(ETHYLFERROCENYL)PROPANE;1,1-(1-Methylethylidene)BIS(Ethylferrocene);1,1-isopropylidenebis(ethylferrocene)";2,2-Bis(ethylferrocenyl)propane (BEFP);2,2-Bis(ethyldicyclopentadienyl iron)propane;2,2'-bis(ethylferrocenyl)propane(catocene);Catocene |
| CAS: | 37206-42-1 |
| MF: | C17H22Fe10* |
| MW: | 282.2 |
| EINECS: | 310-202-3 |
| Product Categories: | Industrial/Fine Chemicals |
| Mol File: | 37206-42-1.mol |
|
Catocene Chemical Properties
| density | 1.296[at 20℃] |
| vapor pressure | 9Pa at 20℃ |
| Water Solubility | 214.1μg/L at 25℃ |
| InChI | InChI=1S/C17H22.Fe/c1-5-13-9-7-11-15(13)17(3,4)16-12-8-10-14(16)6-2;/h7-12H,5-6H2,1-4H3; |
| InChIKey | JFQLVOODHKKQLO-UHFFFAOYSA-N |
| SMILES | [C]1([CH][CH][CH][C]1CC)C(C)(C)[C]1[CH][CH][CH][C]1CC.[Fe] |^1:0,1,2,3,4,10,11,12,13,14| |
| LogP | 5.69 at 20℃ |
| CAS DataBase Reference | 37206-42-1 |
Safety Information
Catocene Usage And Synthesis
Catocene Preparation Products And Raw materials