Introduction：Basic information about CHROMOTROPE 2B CAS 548-80-1, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
CHROMOTROPE 2B Basic information
| Product Name: | CHROMOTROPE 2B |
| Synonyms: | 2,7-Naphthalenedisulfonicacid,4,5-dihydroxy-3-[(4-nitrophenyl)azo-]-,disodiumsalt;7-naphthalenedisulfonicacid,4,5-dihydroxy-3-[(4-nitrophenyl)azo]-disodium;AcidRed176(16575);Chromotropicacid2B;C.I.Acid Red 176;C.I.Mordant Black 93;Chromotrope Red 4B;Sodium 2-(p-nitrophenylazo)chromotropate |
| CAS: | 548-80-1 |
| MF: | C16H12N3NaO10S2 |
| MW: | 493.39 |
| EINECS: | 208-959-9 |
| Product Categories: | |
| Mol File: | 548-80-1.mol |
|
CHROMOTROPE 2B Chemical Properties
| Melting point | 300 °C |
| storage temp. | room temp |
| solubility | water: 10 mg/mL |
| Colour Index | 16575 |
| form | Crystalline Powder |
| color | Dark green to dark purple |
| Water Solubility | water: 10mg/mL |
| ε(extinction coefficient) | ≥500 at 509-519nm in water |
| Merck | 14,2240 |
| BRN | 4109733 |
| Major Application | diagnostic assay manufacturing
hematology
histology |
| InChIKey | AXUUHWJXDWBCSG-QIKYXUGXSA-L |
| SMILES | [Na+].[Na+].Oc1cc(cc2cc(c(\N=N\c3ccc(cc3)[N+]([O-])=O)c(O)c12)S([O-])(=O)=O)S([O-])(=O)=O |
| CAS DataBase Reference | 548-80-1(CAS DataBase Reference) |
| EPA Substance Registry System | 2,7-Naphthalenedisulfonic acid, 4,5-dihydroxy-3-[(4-nitrophenyl)azo]-, disodium salt (548-80-1) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| Storage Class | 11 - Combustible Solids |
CHROMOTROPE 2B Usage And Synthesis
| Chemical Properties | dark green to dark purple crystalline powder |
| Uses | Chromotrope 2B is a chromotropic acid azo dye and a groundwater pollutant removed from the environment via photoelectrochemical mineralization. |
| Uses | As a dye; as a reagent for boric acid or borates. |
| Preparation | 4-Nitrobenzenamine diazo, and 4,5-Dihydroxynaphthalene-2,7-disulfonic acid?coupling. |
| Properties and Applications | blue-ray red. Soluble in water for yellow light red, not soluble in alcohol. The strong sulfuric acid for dark purple, diluted into yellow light red solution. In water solution to join hydrochloric acid solution to become yellow, add sodium hydroxide for blue-ray red.
| Standard | Light Fastness | Soaping | Persperation Fastness | Oxygen bleaching | Fastness to seawater | | Fading | Stain | Fading | Stain | Fading | Stain | | ISO | 6-7 | 4 | | 4 | | | 4-5 | | |
CHROMOTROPE 2B Preparation Products And Raw materials
| Raw materials | N-Methyl-4-nitroaniline-->CHROMOTROPIC ACID SODIUM SALT-->1,8-Dihydroxynaphthylene-3,6-disulfonic acid-->4-Nitroaniline |
| Preparation Products | ACID VIOLET 3 |
