Introduction：Basic information about Cichoric acid CAS 70831-56-0, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Cichoric acid Basic information
| Product Name: | Cichoric acid |
| Synonyms: | (2r,3r)-2,3-bis[[(e)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy]butanedioic acid;(2R,3R)-2,3-BIS[[(2E)-3-(3,4-DIHYDROXYPHENYL)-1-OXO-2-PROPENYL]OXY]-BUTANE DIOIC ACID;CHICHORIC ACID;CICHORIC ACID;Echinacea purpurea(Linn.) Moench;CICHORINIC ACID;DICAFFEOYL TARTARIC ACID;L-CHICORIC ACID |
| CAS: | 70831-56-0 |
| MF: | C22H18O12 |
| MW: | 474.37 |
| EINECS: | |
| Product Categories: | chemical reagent;pharmaceutical intermediate;phytochemical;reference standards from Chinese medicinal herbs (TCM).;standardized herbal extract |
| Mol File: | 70831-56-0.mol |
|
Cichoric acid Chemical Properties
| Melting point | 206°C(lit.) |
| Boiling point | 46-47 °C |
| density | 1.641±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | DMSO: 100 mg/mL (210.81 mM) |
| pka | 1.42±0.25(Predicted) |
| form | powder to crystal |
| color | White to Light yellow to Light orange |
| λmax | 327nm(lit.) |
| Major Application | food and beverages |
| InChIKey | YDDGKXBLOXEEMN-IABMMNSOSA-N |
| SMILES | C(O)(=O)[C@H](OC(=O)/C=C/C1=CC=C(O)C(O)=C1)[C@@H](OC(=O)/C=C/C1=CC=C(O)C(O)=C1)C(O)=O |
| CAS DataBase Reference | 70831-56-0(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 22-42/43 |
| Safety Statements | 22-36/37-45-24/25 |
| WGK Germany | 3 |
| RTECS | EJ9852090 |
| HS Code | 29182900 |
| Storage Class | 11 - Combustible Solids |
Cichoric acid Usage And Synthesis
| Chemical Properties | White powder |
| Uses | food and beverages |
| Definition | ChEBI: Chicoric acid is an organooxygen compound. It has a role as a HIV-1 integrase inhibitor and a geroprotector. It is functionally related to a tetracarboxylic acid. |
| IC 50 | HIV-1 |
Cichoric acid Preparation Products And Raw materials
