Introduction：Basic information about CLENBUTEROL D9 CAS 129138-58-5, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
CLENBUTEROL D9 Basic information
| Product Name: | CLENBUTEROL D9 |
| Synonyms: | 4-amino-3,5-dichloro-.alpha.-[[[1,1-di(methyl-d3)ethyl-2,2,2-d3]amino]methyl]Benzenemethanol;4-Amino-α-(tert-butyl-d9-aminomethyl)-3,5-dichlorobenzyl alcohol, 1-(4-Amino-3,5-dichlorophenyl)-2-(tert-butyl-d9-amino)ethanol;Clenbuterol-D9;(±)-Clenbuterol D9 (trimethyl D9);1-(4-Amino-3,5-dichlorophenyl)-2-(tert-butyl-d9-amino)ethanol;4-Amino-α-(tert-butyl-d9-aminomethyl)-3,5-dichlorobenzyl alcohol;4-amino-3,5-dichloro-.α.-[[[1,1-di(methyl-d3)ethyl-2,2,2-d3]amino]methyl]Benzenemethanol;4-Amino-3,5-dichloro-α-[[(1,1-dimethylethyl-d9)amino]methyl]benzenemethanol |
| CAS: | 129138-58-5 |
| MF: | C12H9Cl2D9N2O |
| MW: | 286.248 |
| EINECS: | 253-366-0 |
| Product Categories: | Intermediates & Fine Chemicals;Isotope Labeled Compounds;Pharmaceuticals;Isotope Labelled Compounds |
| Mol File: | 129138-58-5.mol |
|
CLENBUTEROL D9 Chemical Properties
| Melting point | 112-115°C |
| storage temp. | Hygroscopic, -20°C Freezer, Under Inert Atmosphere |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| color | White to Off-White |
| Stability: | Store in Freezer |
| InChI | InChI=1S/C12H18Cl2N2O/c1-12(2,3)16-6-10(17)7-4-8(13)11(15)9(14)5-7/h4-5,10,16-17H,6,15H2,1-3H3/i1D3,2D3,3D3 |
| InChIKey | STJMRWALKKWQGH-GQALSZNTSA-N |
| SMILES | C(C([2H])([2H])[2H])(C([2H])([2H])[2H])(C([2H])([2H])[2H])NCC(O)C1C=C(C(N)=C(Cl)C=1)Cl |
Safety Information
| Hazard Codes | T,Xn |
| Risk Statements | 25-22 |
| Safety Statements | 22-36/37/39-45 |
| RIDADR | UN2811 6.1/PG 3 |
| WGK Germany | WGK 3 |
| HS Code | 28459000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
CLENBUTEROL D9 Usage And Synthesis
| Chemical Properties | White Crystalline Solid |
| Uses | A β-Agonist, CLENBUTEROL D9 can be used as a growth promoter in farm animals. |
| Uses | A -Agonist which can be used as a growth promoter in farm animals |
CLENBUTEROL D9 Preparation Products And Raw materials
