Introduction：Basic information about CU-CPT-8m CAS 125079-83-6, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
CU-CPT-8m Basic information
| Product Name: | CU-CPT-8m |
| Synonyms: | CPD1578;CU-CPT-8m;cas 125079-83-6;CU-CPT-8M;CAS 125079-83-6 ;TLR8 INHIBITOR;TLR8-specific antagonist;7-(m-tolyl)pyrazolo[1,5-a]pyrimidine-3-carboxamide;Pyrazolo[1,5-a]pyrimidine-3-carboxamide, 7-(3-methylphenyl)-;CU CPT 8m,inhibit,Toll-like Receptor (TLR),CUCPT8m,Inhibitor |
| CAS: | 125079-83-6 |
| MF: | C14H12N4O |
| MW: | 252.27 |
| EINECS: | |
| Product Categories: | |
| Mol File: | 125079-83-6.mol |
|
CU-CPT-8m Chemical Properties
| density | 1.35±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform: 5 mg/ml; DMF: 0.2 mg/ml; DMSO: 0.2 mg/ml; Ethanol: slightly soluble |
| form | A crystalline solid |
| pka | 12.41±0.50(Predicted) |
| color | White to off-white |
| InChI | InChI=1S/C14H12N4O/c1-9-3-2-4-10(7-9)12-5-6-16-14-11(13(15)19)8-17-18(12)14/h2-8H,1H3,(H2,15,19) |
| InChIKey | HNKGGVGQAVODNJ-UHFFFAOYSA-N |
| SMILES | C12=C(C(N)=O)C=NN1C(C1=CC=CC(C)=C1)=CC=N2 |
Safety Information
CU-CPT-8m Usage And Synthesis
| Uses | CU-CPT-8m is a specific TLR8 antagonist, with an IC50 of 67 nM. |
| IC 50 | TLR8: 67 nM (IC50) |
| References | [1] Zhang S, et al. Small-molecule inhibition of TLR8 through stabilization of its resting state. Nat Chem Biol. 2018 Jan;14(1):58-64. DOI:10.1038/nchembio.2518 |
CU-CPT-8m Preparation Products And Raw materials
