Curcumenol CAS 19431-84-6
Introduction：Basic information about Curcumenol CAS 19431-84-6, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
Curcumenol Basic information
| Product Name: | Curcumenol |
| Synonyms: | 3,8-dimethyl-5-(1-methylethylidene)-,(3S,3aS,6R,8aS)-;6H-3a,6-Epoxyazulen-6-ol,1,2,3,4,5,8a-hexahydro-;(3S,3alphaS,6R,8alphaS)-1,2,3,4,5,8alpha-Hexahydro-3,8-dimethyl-5-(1-methylethylidene)-6H-3alpha,6-epoxyazulen-6-ol;oil of zedoary turmeric;6H-3a,6-Epoxyazulen-6-ol, 1,2,3,4,5,8a-hexahydro-3,8-dimethyl-5-(1-methylethylidene)-, (3S,3aS,6R,8aS)-;(+)-Curcumenol;3,8-dimethyl-5-(1-methylethylidene)-1,2,3,4,5,8a-hexahydro-6h-3a,6-epoxyazulen-6-ol;CYPs,Cytochrome P450,Inhibitor,inhibit,Curcumenol |
| CAS: | 19431-84-6 |
| MF: | C15H22O2 |
| MW: | 234.33 |
| EINECS: | |
| Product Categories: | |
| Mol File: | 19431-84-6.mol |
Curcumenol Chemical Properties
| Melting point | 113-115 °C |
| Boiling point | 349.3±42.0 °C(Predicted) |
| density | 1.10 |
| storage temp. | Store at -20°C |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | Powder |
| pka | 12.38±0.60(Predicted) |
| color | White to off-white |
| Odor | at 100.00 %. fresh fatty |
| Odor Type | fatty |
| InChI | InChI=1S/C15H22O2/c1-9(2)13-8-14-11(4)5-6-12(14)10(3)7-15(13,16)17-14/h7,11-12,16H,5-6,8H2,1-4H3/t11-,12-,14-,15+/m0/s1 |
| InChIKey | ISFMXVMWEWLJGJ-NZBPQXDJSA-N |
| SMILES | C1[C@]2([H])[C@@]3(O[C@](O)(C=C2C)/C(=C(\C)/C)/C3)[C@@H](C)C1 |
| LogP | 3.141 (est) |
Safety Information
| Chemical Properties | White needle-shaped crystals, soluble in organic solvents such as methanol, ethanol, and DMSO, derived from Curcuma zedoaria. |
| Uses | Curcumenol is used in methods and formulations for preventing downward migration of agricultural materials. |
| IC 50 | CYP3 |
Curcumenol Preparation Products And Raw materials
| Raw materials | dehydrocurdione-->Isocurcumenol |
