Introduction：Basic information about CYAZOFAMID CAS 120116-88-3, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
CYAZOFAMID Basic information
| Product Name: | CYAZOFAMID |
| Synonyms: | 4-Chloro-2-cyano-N,N-dimethyl-5-(4-methylphenyl)-1H-imidazole-1-sulfonamide;4-Chloro-2-cyano-N,N-diMethyl-5-p-tolyliMidazole-1-sulfonaMide;BAS 54500F;CyaMidazosulfaMid;FendazosulaM;4-chloro-2-cyano-N,N-diMethyl-5-(p-tolyl)-1H-iMidazole-1-sulfonaMide;Cyazofamid Solution, 1000ppm;-1H-imidazole-1-sulfonamide |
| CAS: | 120116-88-3 |
| MF: | C13H13ClN4O2S |
| MW: | 324.79 |
| EINECS: | 601-671-8 |
| Product Categories: | |
| Mol File: | 120116-88-3.mol |
|
CYAZOFAMID Chemical Properties
| Melting point | 152.7° |
| Boiling point | 498.2±37.0 °C(Predicted) |
| density | 1.38±0.1 g/cm3(Predicted) |
| Fp | 4 °C |
| storage temp. | -20°C |
| solubility | DMF: 15 mg/ml; DMSO: 10 mg/ml |
| pka | -6.61±0.70(Predicted) |
| form | Solid |
| color | White to off-white |
| Major Application | agriculture
environmental |
| InChI | InChI=1S/C13H13ClN4O2S/c1-9-4-6-10(7-5-9)12-13(14)16-11(8-15)18(12)21(19,20)17(2)3/h4-7H,1-3H3 |
| InChIKey | YXKMMRDKEKCERS-UHFFFAOYSA-N |
| SMILES | C1(C#N)N(S(N(C)C)(=O)=O)C(C2=CC=C(C)C=C2)=C(Cl)N=1 |
| LogP | 1.750 (est) |
| EPA Substance Registry System | Cyazofamid (120116-88-3) |
Safety Information
| Hazard Codes | F,Xn,N |
| Risk Statements | 11-38-48/20-63-65-67-20/21/22-50/53-52/53 |
| Safety Statements | 36/37-62-36-61-60-16 |
| RIDADR | UN1294 3/PG 2 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1
Aquatic Chronic 1 |
| Hazardous Substances Data | 120116-88-3(Hazardous Substances Data) |
| Toxicity | LD50 orally in mice, rats: >5000, >5000 mg/kg; dermally in rats: >2000 mg/kg; LC50 in rats: >5.5 mg/l by inhalation; LC50 (48 hr) in carp, rainbow trout: >69.6, >100 mg/l (Mitani) |
CYAZOFAMID Usage And Synthesis
| Chemical Properties | Pale yellow, odorless powdery solid, mp 152.7℃, vapor pressure <1.33×10-5 Pa, solubility in water at 20℃ is 0.121 μg/mL (pH=5), and the partition coefficient is 3.2 (25℃). |
| Uses | Cyazofamid is a imidazole fungicide for use on food crops. |
| Uses | Agricultural fungicide. |
| Definition | ChEBI: A member of the class of imidazoles carrying dimethylsulfamyl, cyano, chloro and 4-tolyl substituents at positions 1, 2, 4 and 5 respectively. A fungicide used mainly for controlling Oomycete and Plasmodiophora diseases on potatoe and tomatoes. It is a skin and eye irritant and is moderately toxic to birds, most aquatic organisms, honeybees and earthworms. |
CYAZOFAMID Preparation Products And Raw materials
| Raw materials | Glyoxal-->4'-Methylacetophenone |
