Introduction：Basic information about D-Cystine CAS 349-46-2, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
D-Cystine Basic information
| Product Name: | D-Cystine |
| Synonyms: | D(+)-3,3'-DITHIOBIS(2-AMINOPROPANOIC ACID);D(+)-CYSTINE;D-CYSTINE;(H-D-CYS-OH)2;H-D-CYSTINE;(S,S)-3,3'-DITHIOBIS(2-AMINOPROPIONIC ACID);H-D-(Cys)_2-OH~(+)-3,3-Dithiobis(2-aminopropionic acid);D-CYSTINE CRYSTALLINE |
| CAS: | 349-46-2 |
| MF: | C6H12N2O4S2 |
| MW: | 240.3 |
| EINECS: | 206-486-2 |
| Product Categories: | Amino Acids;API |
| Mol File: | 349-46-2.mol |
|
D-Cystine Chemical Properties
| Melting point | 265 °C (dec.) (lit.) |
| alpha | 214 º (c=1, 1 N HCl) |
| Boiling point | 468.2±45.0 °C(Predicted) |
| density | 1.358 (estimate) |
| refractive index | 1.6000 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Aqueous Acid (Slightly), Aqueous Base (Slightly) |
| pka | 1.70±0.10(Predicted) |
| form | Fine Crystalline Powder |
| color | White |
| Optical Rotation | [α]20/D +212°, c = 1 in 1 M HCl |
| Water Solubility | 0.057 g/L (25 ºC) |
| Merck | 14,2782 |
| BRN | 1728093 |
| Major Application | peptide synthesis |
| InChI | 1S/C6H12N2O4S2/c7-3(5(9)10)1-13-14-2-4(8)6(11)12/h3-4H,1-2,7-8H2,(H,9,10)(H,11,12)/t3-,4-/m1/s1 |
| InChIKey | LEVWYRKDKASIDU-QWWZWVQMSA-N |
| SMILES | N[C@H](CSSC[C@@H](N)C(O)=O)C(O)=O |
| LogP | 1.230 (est) |
| CAS DataBase Reference | 349-46-2(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn,Xi |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 22-24/25-37/39-26-36 |
| WGK Germany | 3 |
| HS Code | 29309013 |
| Storage Class | 11 - Combustible Solids |
D-Cystine Usage And Synthesis
| Description | D-cystine is a thiol-containing non-essential amino acid that is oxidized to form CYSTINE. |
| Chemical Properties | White crystals |
| Uses | D-Cystine increases the rate of fertilization of mouse oocytes. |
| Definition | ChEBI: The D-enantiomer of cystine. |
| Biological Functions | D-Cystine functions as an antioxidant and protects tissues against radiation and pollution, slowing the aging process. It also aids protein synthesis. Cystine is abundant in many proteins of skeletal tissues and skin, and found in insulin and digestive enzymes chromotrypsinogen A, papain, and trypsinogen. |
| reaction suitability | reaction type: solution phase peptide synthesis |
D-Cystine Preparation Products And Raw materials
